
CAS Number77901-52-1
SynonymsMethyl2-Methoxy-6-nitrobenzoate; 2-methoxy-6-nitro-benzoic acid methyl ester; Methyl 2-methoxy-6-nitrobenzoate; Benzoic acid, 2-methoxy-6-nitro-, methyl ester; 2-Methoxy-6-nitro-benzoesaeure-methylester
Molecular FormulaC9H9NO5
Molecular Weight211.18
Density1.3±0.1 g/cm3
Boiling Point326.5±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 77901-52-1 |
| Catalog No. | 2A-9087303 |
| Chinese Name | 2-甲氧基-6-硝基苯甲酸甲酯 |
| Synonyms | Methyl2-Methoxy-6-nitrobenzoate; 2-methoxy-6-nitro-benzoic acid methyl ester; Methyl 2-methoxy-6-nitrobenzoate; Benzoic acid, 2-methoxy-6-nitro-, methyl ester; 2-Methoxy-6-nitro-benzoesaeure-methylester |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.18 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 326.5±22.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| MDL Number | MFCD11656789 |
| SMILES | COC(=O)c1c(OC)cccc1[N+](=O)[O-] |
| InChI Key | IKGPBKXTVWMPQY-UHFFFAOYSA-N |
| MSDS | msds/87303_1_77901_52_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl4-(Chlorosulfonyl)benzoate | 69812-51-7 | 2A-9087281 |
| 3-MethylsulfonylphenylaceticAcid | 1877-64-1 | 2A-9087285 |
| 4-(1,3-Oxazol-5-yl)benzoicAcid | 250161-45-6 | 2A-9087287 |
| MethylsulfamoylChloride | 10438-96-7 | 2A-9087288 |
| 3-Chloro-5-nitrobenzoicAcid | 34662-36-7 | 2A-9087301 |
| Methyl2,3-Dimethylbenzoate | 15012-36-9 | 2A-9087306 |
| Ethyl2,3-Dimethylbenzoate | 104175-24-8 | 2A-9087307 |
| 2-Amino-4-(1H-imidazol-1-yl)benzoicAcid | 1141669-47-7 | 2A-9087308 |
| 2-Amino-4-(1H-pyrazol-1-yl)benzoicAcid | 1186663-55-7 | 2A-9087309 |
| 2-Amino-4-morpholinobenzoicAcid | 404010-74-8 | 2A-9087310 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA