
CAS Number883-20-5
Synonyms9-methyl phenanthrene; Phenanthrene,9-methyl; 9-Methyl-phenanthren; EINECS 212-930-6; 9-methylphenathrene
Molecular FormulaC16H13Br
Molecular Weight285.186
Boiling Point353.5 °C at 760 mmHg (lit.)
Melting Point90-91℃
AppearanceColorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 883-20-5 |
| Catalog No. | 2A-9087223 |
| Chinese Name | 9-甲基菲 |
| Synonyms | 9-methyl phenanthrene; Phenanthrene,9-methyl; 9-Methyl-phenanthren; EINECS 212-930-6; 9-methylphenathrene |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.186 |
| Boiling Point | 353.5 °C at 760 mmHg (lit.) |
| Melting Point | 90-91℃ |
| Appearance | Colorless to yellow liquid |
| Storage Condition | 2-8°C, dry |
| HTC | 2902909090 |
| MDL Number | MFCD00155023 |
| SMILES | Cc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C15H12/c1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15/h2-10H,1H3 |
| InChI Key | DALBHIYZSZZWBS-UHFFFAOYSA-N |
| MSDS | msds/87223_1_883_20_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2902909090 other aromatic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,3'-Dibromo-2,2'-dimethoxy-1,1'-binaphthyl | 75714-59-9 | 2A-9087218 |
| 9,10-Dihydrophenanthrene | 776-35-2 | 2A-9087219 |
| 1-Methylphenanthrene | 832-69-9 | 2A-9087220 |
| 3-Methylphenanthrene | 832-71-3 | 2A-9087221 |
| NaphtholAS-OLphosphate | 84522-15-6 | 2A-9087222 |
| 4-Chlorophenylglycidylether | 2212-05-7 | 2A-9087225 |
| 3-(Methylsulfonamido)benzoicAcid | 28547-13-9 | 2A-9087228 |
| 2,4,6-Trimethyl-1,3-benzenedimethanethiol | 10074-13-2 | 2A-9087229 |
| 4-(Methylsulphonylamino)phenylaceticAcid | 56205-88-0 | 2A-9087230 |
| 3-(Methylsulphonylamino)phenylaceticAcid | 407640-21-5 | 2A-9087231 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA