
CAS Number145-74-4
Synonyms8-chloronapthalene-1-sulfonic acid; 8-CHLORONAPHTHALENE-1-SULFONIC ACID DIHYDRATE; 8-Chlor-naphthalin-sulfonsaeure-(1); 8-Chloro-1-naphthalenesulfonic acid; 8-chloro-naphthalene-1-sulfonic acid; 8-chloronaphthalene-1-sulphonic acid; 8-Chlor-naphthalin-1-sulfonsaeure; EINECS 205-661-0
Molecular FormulaC10H7O3Cl1S1
Molecular Weight242.68
Density1.533g/cm3
Melting Point145ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 145-74-4 |
| Catalog No. | 2A-9087088 |
| Chinese Name | 8-氯萘-1-磺酸 |
| Synonyms | 8-chloronapthalene-1-sulfonic acid; 8-CHLORONAPHTHALENE-1-SULFONIC ACID DIHYDRATE; 8-Chlor-naphthalin-sulfonsaeure-(1); 8-Chloro-1-naphthalenesulfonic acid; 8-chloro-naphthalene-1-sulfonic acid; 8-chloronaphthalene-1-sulphonic acid; 8-Chlor-naphthalin-1-sulfonsaeure; EINECS 205-661-0 |
| Molecular Formula | C10H7O3Cl1S1 |
| Molecular Weight | 242.68 |
| Density | 1.533g/cm3 |
| Melting Point | 145ºC |
| Storage Condition | Store sealed in a dry and cool place. |
| HTC | 2904909090 |
| MDL Number | MFCD00052379 |
| SMILES | O=S(=O)(O)c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C10H7ClO3S/c11-8-5-1-3-7-4-2-6-9(10(7)8)15(12,13)14/h1-6H,(H,12,13,14) |
| InChI Key | OPFNCYFEIBUZHU-UHFFFAOYSA-N |
| MSDS | msds/87088_1_145_74_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-Bromoethyl)naphthalene | 13686-49-2 | 2A-9087083 |
| 3-Methoxy-4-pyrrolidinoanilineDihydrochloride | 1186663-17-1 | 2A-9087084 |
| 3-Hydroxy-2-naphthanilidephosphate | 13989-98-5 | 2A-9087085 |
| 3-Methoxy-4-morpholinoanilineDihydrochloride | 1226776-91-5 | 2A-9087086 |
| 3,5-Dinitroacetophenone | 14401-75-3 | 2A-9087087 |
| 3-Nitrophenanthrene | 17024-19-0 | 2A-9087091 |
| Naphtholas-clphosphate | 18228-16-5 | 2A-9087092 |
| 2-Fluorophenethylamine | 52721-69-4 | 2A-9087093 |
| Naphtholas-ephosphate | 18228-17-6 | 2A-9087094 |
| [2-(2-Fluorophenyl)ethyl]methylamine | 485404-58-8 | 2A-9087095 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA