
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37885-41-9 |
| Catalog No. | 2A-9086952 |
| Chinese Name | 2',4'-二氯苯丙酮 |
| Synonyms | MFCD00027396; EINECS 253-700-5; 2',4'-Dichloropropiophenone; 1-(2,4-dichlorophenyl)propan-1-one |
| Molecular Formula | C9H8O1Cl2 |
| Molecular Weight | 203.07 |
| Density | 1,287 g/cm3 |
| Boiling Point | 121-123°C 7mm |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2914700090 |
| MDL Number | MFCD00027396 |
| SMILES | CCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| InChI Key | FBMTWRZQBRHOPF-UHFFFAOYSA-N |
| MSDS | msds/86952_1_37885_41_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2',4'-Dichloropropiophenone Modification number: 5 |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1-(T-Butyloxycarbonyl)-2-triphenylphosphoniumhydrazineBromide | 356534-53-7 | 2A-9086871 |
| 1-(2,4-diethoxy-phenyl)-ethanone | 22924-18-1 | 2A-9086883 |
| 2,4-Dichloro-6-methylpyrimidine-5-carbonitrile | 56035-64-4 | 2A-9086910 |
| 2,4,5-Trichlorothiophenol | 3773-14-6 | 2A-9086946 |
| 2,4,5-Trimethylthiophenol | 58348-14-4 | 2A-9086948 |
| 5-Chloro-2,4-dimethoxyphenylisocyanate | 55440-55-6 | 2A-9087017 |
| 5-Chloro-2,4-dimethoxyphenylisothiocyanate | 40046-27-3 | 2A-9087026 |
| N-Ethyl-2,4-dichlorobenzylamine | 90390-15-1 | 2A-9087046 |
| 1-(2,4-Difluorophenyl)cyclopropylamineHydrochloride | 1186663-18-2 | 2A-9087107 |
| 2-Methoxy-2,4-diphenyl-3(2H)-furanone | 50632-57-0 | 2A-9087167 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA