
CAS Number73219-89-3
Synonyms3-Brom-2,6-dimethoxy-benzoesaeure; 2,6-dimethoxy-5-bromobenzoic acid; 5-bromo-2,6-dimethoxybenzoic acid; MFCD00052933; 06B; 2,6-dimethoxy-3-bromobenzoic acid
Molecular FormulaC9H9BrO4
Molecular Weight261.074
Density1.571g/cm3
Boiling Point359.8ºC at 760 mmHg
Melting Point146 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73219-89-3 |
| Catalog No. | 2A-9086789 |
| Chinese Name | 3-溴-2,6-二甲氧基苯甲酸 |
| Synonyms | 3-Brom-2,6-dimethoxy-benzoesaeure; 2,6-dimethoxy-5-bromobenzoic acid; 5-bromo-2,6-dimethoxybenzoic acid; MFCD00052933; 06B; 2,6-dimethoxy-3-bromobenzoic acid |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.074 |
| Density | 1.571g/cm3 |
| Boiling Point | 359.8ºC at 760 mmHg |
| Melting Point | 146 °C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918990090 |
| MDL Number | MFCD00052933 |
| SMILES | COc1ccc(Br)c(OC)c1C(=O)O |
| InChI | InChI=1S/C9H9BrO4/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12)/p-1 |
| InChI Key | CUQANLQRQJHIQE-UHFFFAOYSA-N |
| MSDS | msds/86789_1_73219_89_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Aminovalericacidhydrochloride | 627-95-2 | 2A-9086764 |
| 4-Phenoxyphenylaceticacid | 6328-74-1 | 2A-9086767 |
| Morpholin-4-yl-phenyl-aceticacid | 6342-19-4 | 2A-9086770 |
| 2-Ethoxyphenylaceticacid | 70289-12-2 | 2A-9086783 |
| 4-Benzyloxy-3-methoxycinnamicacid | 7152-95-6 | 2A-9086786 |
| v | 1614-06-8 | 2A-9086790 |
| BAPTAtetraethylester | 73630-07-6 | 2A-9086794 |
| 4-(Imidazol-2-yl)benzonitrile | 98298-49-8 | 2A-9086797 |
| 4-Aminobenzylsuccinicacid | 75043-31-1 | 2A-9086798 |
| 4-Pentene-1,2-dicarboxylicanhydride | 7539-12-0 | 2A-9086802 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA