![5-[3-(Trifluoromethyl)phenyl]-1H-tetrazole structure, CAS 92712-48-6](/structures/100000/86760_1_92712_48_6.png)
CAS Number92712-48-6
Synonyms5-[3-(trifluoromethyl)phenyl]-1H-tetrazole; 5-(3-Trifluoromethyl-phenyl)-2H-tetrazole; 5-[3-(trifluoromethyl)phenyl]-2h-1,2,3,4-tetraazole; 5-[3-(trifluoromethyl)phenyl]-2H-1,2,3,4-tetrazole; MFCD00068098
Molecular FormulaC12H9F3N2O2
Molecular Weight214.14700
Density1.464g/cm3
Boiling Point325.2ºC at 760 mmHg
Melting Point156-158°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 92712-48-6 |
| Catalog No. | 2A-9086760 |
| Chinese Name | 5-[3-(三氟甲基)苯基]-2H-四唑 |
| Synonyms | 5-[3-(trifluoromethyl)phenyl]-1H-tetrazole; 5-(3-Trifluoromethyl-phenyl)-2H-tetrazole; 5-[3-(trifluoromethyl)phenyl]-2h-1,2,3,4-tetraazole; 5-[3-(trifluoromethyl)phenyl]-2H-1,2,3,4-tetrazole; MFCD00068098 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 214.14700 |
| Density | 1.464g/cm3 |
| Boiling Point | 325.2ºC at 760 mmHg |
| Melting Point | 156-158°C |
| Storage Condition | If used and stored according to regulations, it wi |
| HTC | 2933990090 |
| SMILES | O=C(OC)C1=CC(C2=CC=C(C(F)(F)F)C=C2)=NN1 |
| InChI | 1S/C12H9F3N2O2/c1-19-11(18)10-6-9(16-17-10)7-2-4-8(5-3-7)12(13,14)15/h2-6H,1H3,(H,16,17) |
| InChI Key | BNSJOULIOYICPD-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/86760_1_92712_48_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-(3-Nitrophenyl)thiazole-2-carboxylicAcid | 185245-05-0 | 2A-9086748 |
| 2-Amino-5-(2-bromophenyl)furan-3-carbonitrile | 1261268-90-9 | 2A-9086750 |
| 2-Amino-5-(3-bromophenyl)furan-3-carbonitrile | 1261268-89-6 | 2A-9086751 |
| 2-Amino-5-(4-bromophenyl)furan-3-carbonitrile | 26454-86-4 | 2A-9086753 |
| 5-[4-(1-Imidazolyl)phenyl]-2H-tetrazole | 188890-72-4 | 2A-9086758 |
| 5-(2-Fluoro-5-nitrophenyl)-2H-tetrazole | 1171938-74-1 | 2A-9086763 |
| 5-(4-Bromo-2-fluorophenyl)-2H-tetrazole | 530081-35-7 | 2A-9086765 |
| 5-(3-Bromo-4-fluorophenyl)-2H-tetrazole | 874784-10-8 | 2A-9086766 |
| 5-[4-(Methylsulfonyl)phenyl]-2H-tetrazole | 441054-54-2 | 2A-9086768 |
| 5-[4-(Methylsulfonamido)phenyl]-2H-tetrazole | 1261268-83-0 | 2A-9086769 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA