
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51362-37-9 |
| Catalog No. | 2A-9086681 |
| Chinese Name | 2-(4-氯苯氧基)烟酸 |
| Synonyms | 2-(4-chlorophenoxy)nicotinic acid; 2-(4-Chlorphenoxy)nicotinsaeure; MFCD00052116 |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.655 |
| Density | 1.404g/cm3 |
| Boiling Point | 396.6ºC at 760mmHg |
| Melting Point | 157-159°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933399090 |
| MDL Number | MFCD00052116 |
| SMILES | O=C(O)c1cccnc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H8ClNO3/c13-8-3-5-9(6-4-8)17-11-10(12(15)16)2-1-7-14-11/h1-7H,(H,15,16)/p-1 |
| InChI Key | FVAZJGJEENAKRJ-UHFFFAOYSA-N |
| MSDS | msds/86681_1_51362_37_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3'-Pyridyl)phenylaceticacid | 51061-71-3 | 2A-9086667 |
| 4-Acetylaminocinnamicacid | 7152-04-7 | 2A-9086668 |
| 6-Acetoxy-N-caproicacidmethylester | 104954-58-7 | 2A-9086673 |
| Aceticacidtridecylester | 1072-33-9 | 2A-9086677 |
| 4-Acetoxy-7-methylindane | 131447-89-7 | 2A-9086680 |
| 4-Benzyloxy-3-methylbutyricacid | 132437-90-2 | 2A-9086683 |
| 4-(3,4-Dimethoxyphenyl)butyricacid | 13575-74-1 | 2A-9086684 |
| 4-Chloro-2-methylbutyricacidmethylester | 13888-03-4 | 2A-9086688 |
| 1-Acetoxy-1,1,3,3,5,5-hexamethyltrisiloxane | 139722-91-1 | 2A-9086692 |
| Methyl3-chlorophenylacetate | 53088-68-9 | 2A-9086693 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA