
CAS Number35620-71-4
SynonymsMFCD00014629; 2-phenoxy-nicotinic acid; 2-PHENOXYNICOTINIC ACID; 3-Pyridinecarboxylic acid,2-phenoxy; EINECS 252-647-5; 2-Phenoxy-3-pyridinecarboxylic acid; 2-Phenoxy-nicotinsaeure
Molecular FormulaC12H9NO3
Molecular Weight215.20500
Density1.298g/cm3
Boiling Point368.5ºC at 760mmHg
Melting Point172-175 °C
Appearancebeige powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35620-71-4 |
| Catalog No. | 2A-9086620 |
| Chinese Name | 2-苯氧基烟酸 |
| Synonyms | MFCD00014629; 2-phenoxy-nicotinic acid; 2-PHENOXYNICOTINIC ACID; 3-Pyridinecarboxylic acid,2-phenoxy; EINECS 252-647-5; 2-Phenoxy-3-pyridinecarboxylic acid; 2-Phenoxy-nicotinsaeure |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Density | 1.298g/cm3 |
| Boiling Point | 368.5ºC at 760mmHg |
| Melting Point | 172-175 °C |
| Appearance | beige powder |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933399090 |
| SMILES | O=C(O)c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C12H9NO3/c14-12(15)10-7-4-8-13-11(10)16-9-5-2-1-3-6-9/h1-8H,(H,14,15)/p-1 |
| InChI Key | CQGAXJGXGLVFGJ-UHFFFAOYSA-N |
| MSDS | msds/86620_1_35620_71_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-Methylphenyl)propionicacid | 3751-48-2 | 2A-9086612 |
| Methylperfluorooctanoate | 376-27-2 | 2A-9086614 |
| 3-methylpiperazin-2-one | 23936-11-0 | 2A-9086616 |
| 2,3,5-Trichlorobenzoicacid | 50-37-7 | 2A-9086617 |
| Methylperfluorododecanoate | 56554-52-0 | 2A-9086619 |
| MethylDL-2-isothiocyanatobutyrate | 68693-53-8 | 2A-9086621 |
| Allyltert-butylcarbonate | 70122-89-3 | 2A-9086622 |
| 2-(Phenylthio)nicotinicacid | 35620-72-5 | 2A-9086623 |
| Dimethylaminoethanethiolhydrochloride | 13242-44-9 | 2A-9086624 |
| O-Methyl-m-coumaricacid | 17570-26-2 | 2A-9086625 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA