
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2935-63-9 |
| Catalog No. | 2A-9086603 |
| Chinese Name | (2,3-二甲基苯氧基)乙酸 |
| Synonyms | EINECS 220-911-9; MFCD00016814; vic.-o-Xylenoxyessigsaeure; 2,3-xylyloxyacetic acid; 2,3-Dimethylphenoxyacetic acid |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20000 |
| Density | 1.146g/cm3 |
| Boiling Point | 315.2ºC at 760mmHg |
| Melting Point | 186-190 °C |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918990090 |
| SMILES | Cc1cccc(OCC(=O)O)c1C |
| InChI | InChI=1S/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| InChI Key | AVDBMBYECMTQJQ-UHFFFAOYSA-N |
| MSDS | msds/86603_1_2935_63_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl5-chloroisophthalate | 20330-90-9 | 2A-9086596 |
| DimethylL-isothiocyanatosuccinate | 21055-49-2 | 2A-9086597 |
| 2-(difluoromethoxy)-4-chlorobenzoic | 97914-60-8 | 2A-9086599 |
| Thiodiglycolicanhydride | 3261-87-8 | 2A-9086600 |
| 2,2-DimethylnonanoicAcid | 14250-75-0 | 2A-9086602 |
| 3-Chloro-4-hydroxyphenylaceticacid | 33697-81-3 | 2A-9086606 |
| Methyl2-methyl-4-benzyloxyphenylacetate | 223406-97-1 | 2A-9086608 |
| Dibenzylcarbonate | 3459-92-5 | 2A-9086609 |
| Tetradecafluoroazelaicacid | 23453-64-7 | 2A-9086610 |
| 3-phenylisothiazol-5-amine | 14208-52-7 | 2A-9086611 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA