
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25563-02-4 |
| Catalog No. | 2A-9086554 |
| Chinese Name | 2-苯氧基苯乙酸 |
| Synonyms | 2-(2-phenoxyphenyl)acetic acid; MFCD00079778 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Density | 1.217g/cm3 |
| Boiling Point | 370.2ºC at 760 mmHg |
| Melting Point | 89-91ºC |
| Appearance | White to brown solid |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2918990090 |
| SMILES | O=C(O)Cc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C14H12O3/c15-14(16)10-11-6-4-5-9-13(11)17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| InChI Key | CWWCQGGNKDBSNT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-acetyl-4-amino-2-fluorobenzene | 112279-56-8 | 2A-9086547 |
| 6-(2-Piperidylethoxy)-3-pyridylamine | 561277-09-6 | 2A-9086548 |
| [2-(5-Amino(2-pyridyloxy))ethyl]dimethylaminehydrochloridesalt | 884341-06-4 | 2A-9086550 |
| (2-Carbamoylphenoxy)aceticacid | 25395-22-6 | 2A-9086551 |
| Amino(2-bromophenyl)aceticacid | 254762-66-8 | 2A-9086552 |
| Allylmalonicacid | 2583-25-7 | 2A-9086558 |
| Aminocyclopentylmethane-1-thione | 42202-73-3 | 2A-9086563 |
| 1-Amino-2-ethylbutane-1-thione | 98278-52-5 | 2A-9086565 |
| 2-Bromo-5-sulfamoylbenzoicAcid | 22361-61-1 | 2A-9086568 |
| 2-(2-Chloroethoxy)-4'-nitroacetanilide | 811450-82-5 | 2A-9086573 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA