
CAS Number243666-12-8
Synonyms2,3,4-Trifluorophenylacetic acid; 2,3,4-Trifluorobenzene acetic acid; (2,3,4-Trifluorophenyl)acetic acid; 2-(2,3,4-Trifluorophenyl)acetic acid; 2,3,4-Trifluorobenzeneacetic acid; QV1R BF CF DF; MFCD00061235
Molecular FormulaC8H5F3O2
Molecular Weight190.12
Density1.5±0.1 g/cm3
Boiling Point257.9±35.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 243666-12-8 |
| Catalog No. | 2A-9086545 |
| Chinese Name | 2-(2,3,4-三氟苯基)乙酸 |
| Synonyms | 2,3,4-Trifluorophenylacetic acid; 2,3,4-Trifluorobenzene acetic acid; (2,3,4-Trifluorophenyl)acetic acid; 2-(2,3,4-Trifluorophenyl)acetic acid; 2,3,4-Trifluorobenzeneacetic acid; QV1R BF CF DF; MFCD00061235 |
| Molecular Formula | C8H5F3O2 |
| Molecular Weight | 190.12 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 257.9±35.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2916399090 |
| PubChem ID | 329794729 |
| MDL Number | MFCD00061235 |
| SMILES | FC1=C(F)C(F)=CC=C1CC(O)=O |
| InChI | 1S/C8H5F3O2/c9-5-2-1-4(3-6(12)13)7(10)8(5)11/h1-2H,3H2,(H,12,13) |
| InChI Key | OSQPRQRJSJMQRJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/86545_1_243666_12_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-Propynyl)-2,3-dihydroinden-1-amine | 1875-50-9 | 2A-9086538 |
| 3'-Chlorobiphenyl-4-carboxylicacid | 5728-43-8 | 2A-9086539 |
| 4-amino-2-fluoro-5-nitrobenzonitrile | 143151-03-5 | 2A-9086541 |
| 4'-Chlorobiphenyl-2-carboxylicacid | 7079-15-4 | 2A-9086542 |
| 4'-Chlorobiphenyl-3-carboxylicacid | 4655-10-1 | 2A-9086543 |
| 1-acetyl-4-amino-2-fluorobenzene | 112279-56-8 | 2A-9086547 |
| 6-(2-Piperidylethoxy)-3-pyridylamine | 561277-09-6 | 2A-9086548 |
| [2-(5-Amino(2-pyridyloxy))ethyl]dimethylaminehydrochloridesalt | 884341-06-4 | 2A-9086550 |
| (2-Carbamoylphenoxy)aceticacid | 25395-22-6 | 2A-9086551 |
| Amino(2-bromophenyl)aceticacid | 254762-66-8 | 2A-9086552 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA