![4-[4-(1-Butyl)phenyl]-4-oxobutyricacid structure, CAS 72271-71-7](/structures/100000/86502_1_72271_71_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72271-71-7 |
| Catalog No. | 2A-9086502 |
| Chinese Name | 4-[4-(1-丁基)苯基]-4-氧丁酸 |
| Synonyms | 4-(4-Butylphenyl)-4-oxobutanoic acid; 4-Butyl-G-Oxo-Benzenebutanoic Acid; MFCD00173764 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.291 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 418.7±38.0 °C at 760 mmHg |
| Melting Point | 109-111ºC |
| HTC | 2918300090 |
| SMILES | CCCCc1ccc(C(=O)CCC(=O)O)cc1 |
| InChI Key | CQXSYJVVDLNUAJ-UHFFFAOYSA-N |
| MSDS | msds/86502_1_72271_71_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-Butylcrotonate | 3246-27-3 | 2A-9086495 |
| tert-Butyl2-fluoroacrylate | 85345-86-4 | 2A-9086496 |
| 2-(4-Nitrophenyl)propanoicacid | 19910-33-9 | 2A-9086497 |
| 1-Benzyl-5-(hydroxymethyl)piperidin-2-one | 744212-68-8 | 2A-9086498 |
| 3-Fluorophenoxyacetonitrile | 135290-20-9 | 2A-9086500 |
| Ethyl4,5-Difluoro-2-nitrobenzoate | 1214387-06-0 | 2A-9086503 |
| 3,4-Difluorophenylaceticacidmethylester | 210530-71-5 | 2A-9086505 |
| Methyl3-(Methylsulfonyl)phenylacetate | 847150-07-6 | 2A-9086507 |
| N-2-Chloroacetylurethane | 6092-47-3 | 2A-9086508 |
| 6-Phenoxynicotinonitrile | 99902-72-4 | 2A-9086510 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA