CAS Number1878-49-5
Synonyms(2-Methylphenoxy)acetic acid; O-CRESOXYACETIC ACID; α-Methylphenoxyacetic acid; 2-methylphenyloxyacetic acid; IFLAB-BB F1924-0028; o-methylphenoxyacetic acid; EINECS 217-517-4; 2-Methylphenoxyacetic acid; MFCD00014354
Molecular FormulaC9H10O3
Molecular Weight166.174
Density1.2±0.1 g/cm3
Boiling Point288.4±15.0 °C at 760 mmHg
Melting Point155-157 °C(lit.)
Appearancewhite needle crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1878-49-5 |
| Catalog No. | 2A-9086486 |
| Chinese Name | 2-甲苯氧基乙酸 |
| Synonyms | (2-Methylphenoxy)acetic acid; O-CRESOXYACETIC ACID; α-Methylphenoxyacetic acid; 2-methylphenyloxyacetic acid; IFLAB-BB F1924-0028; o-methylphenoxyacetic acid; EINECS 217-517-4; 2-Methylphenoxyacetic acid; MFCD00014354 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.174 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 288.4±15.0 °C at 760 mmHg |
| Melting Point | 155-157 °C(lit.) |
| Appearance | white needle crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| SMILES | Cc1ccccc1OCC(=O)O |
| InChI | InChI=1S/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChI Key | QJVXBRUGKLCUMY-UHFFFAOYSA-N |
| MSDS | msds/86486_2_1878_49_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bis(2-ethoxyethyl)adipate | 109-44-4 | 2A-9086476 |
| Methyl3-Bromo-4-(methylsulfonyl)benzoate | 182003-84-5 | 2A-9086481 |
| (2-Chloro-5-methyl-3-pyridyl)methan-1-ol | 518314-64-2 | 2A-9086483 |
| 4,6-Dihydroxynicotinamide | 5466-41-1 | 2A-9086484 |
| tert-Butoxyaceticacid | 13211-32-0 | 2A-9086485 |
| 4-bromo-5-chloro-2-nitrophenylamine | 827-33-8 | 2A-9086487 |
| 4-Isopropylphenylacetate | 2664-32-6 | 2A-9086489 |
| Ethyl3-PiperidylacetateHydrochloride | 16780-05-5 | 2A-9086490 |
| 4-bromo-5-fluoro-2-nitrophenylamine | 153505-36-3 | 2A-9086491 |
| 3-tert-Butoxypropionicacid | 21150-73-2 | 2A-9086492 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS