
CAS Number54840-15-2
Synonyms2-Methyl-2-propanyl (4-hydroxyphenyl)carbamate; tert-butyl N-(4-hydroxyphenyl)carbamate; MFCD00226573; tert-butyl (4-hydroxyphenyl)carbamate; Carbamic acid, N-(4-hydroxyphenyl)-, 1,1-dimethylethyl ester
Molecular FormulaHOC6H4NHCO2C(CH3)3
Molecular Weight209.24
Purity97%
Density1.2±0.1 g/cm3
Boiling Point288.7±23.0 °C at 760 mmHg
Melting Point143-147 °C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54840-15-2 |
| Catalog No. | 2A-9086482 |
| Chinese Name | 4-(BOC-氨基)酚 |
| Synonyms | 2-Methyl-2-propanyl (4-hydroxyphenyl)carbamate; tert-butyl N-(4-hydroxyphenyl)carbamate; MFCD00226573; tert-butyl (4-hydroxyphenyl)carbamate; Carbamic acid, N-(4-hydroxyphenyl)-, 1,1-dimethylethyl ester |
| Molecular Formula | HOC6H4NHCO2C(CH3)3 |
| Molecular Weight | 209.24 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 288.7±23.0 °C at 760 mmHg |
| Melting Point | 143-147 °C (lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924299090 |
| PubChem ID | 24880871 |
| MDL Number | MFCD00226573 |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(O)cc1 |
| InChI | 1S/C11H15NO3/c1-11(2,3)15-10(14)12-8-4-6-9(13)7-5-8/h4-7,13H,1-3H3,(H,12,14) |
| InChI Key | YRQMBQUMJFVZLF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/86482_1_54840_15_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone | 16251-45-9 | 2A-9086396 |
| (1S,6R)-8-Boc-3,8-diazabicyclo[4.2.0]octane | 851526-80-2 | 2A-9086404 |
| (1R,6S)-8-Boc-3,8-diazabicyclo[4.2.0]octane | 370881-22-4 | 2A-9086407 |
| 3,7-dihydro-pyrrolo[2,3-d]pyrimidine-4-one | 3680-71-7 | 2A-9086410 |
| 8-Bromo-1,6-naphthyridine-2-carboxylicacid | 197507-55-4 | 2A-9086469 |
| Methyl1-Benzyl-2-oxo-1,2,3,4-tetrahydropyridine-5-carboxylate | 156779-10-1 | 2A-9086494 |
| 3-Carboxyphenylisothiocyanate | 2131-63-7 | 2A-9086504 |
| 4-Carboxyphenylisothiocyanate | 2131-62-6 | 2A-9086506 |
| N-Boc-4-bromoindoline | 885272-46-8 | 2A-9086529 |
| 1-Benzoyl-6-bromo-7-azaindole | 143468-12-6 | 2A-9086535 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA