
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14892-14-9 |
| Catalog No. | 2A-9086382 |
| Chinese Name | 五氟苯氧基乙酸 |
| Synonyms | Pentafluorophenoxyacetic Acid; MFCD00004297; EINECS 238-964-1; 2-(2,3,4,5,6-pentafluorophenoxy)acetic acid |
| Molecular Formula | C8H3F5O3 |
| Molecular Weight | 242.103 |
| Density | 1.662g/cm3 |
| Boiling Point | 267.6ºC at 760 mmHg |
| Melting Point | 108-110 °C(lit.) |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2918990090 |
| MDL Number | MFCD00004297 |
| SMILES | O=C(O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H3F5O3/c9-3-4(10)6(12)8(7(13)5(3)11)16-1-2(14)15/h1H2,(H,14,15) |
| InChI Key | SMXPFEBIAASLOR-UHFFFAOYSA-N |
| MSDS | msds/86382_1_14892_14_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl2-chloro-4-nitrobenzoate | 13324-11-3 | 2A-9086367 |
| 4,4'-Bis(3-Methyl-1-phenyl-5-pyrazolone) | 7477-67-0 | 2A-9086369 |
| Methyl3-methylaminocrotonate | 13412-12-9 | 2A-9086371 |
| Thianaphthene-1,1-dioxide | 825-44-5 | 2A-9086372 |
| 3'-Bromo-4'-fluoroacetanilide | 1009-75-2 | 2A-9086377 |
| 3,4-Dihydro-2H-pyran-2-methylamine | 4781-76-4 | 2A-9086384 |
| 2-Amino-4-hydroxypteridine-6-carboxylicacid | 1501-50-4 | 2A-9086385 |
| N-Benzylmaleamicacid | 15329-69-8 | 2A-9086388 |
| N-(3-Bromo-4-fluorophenyl)methanesulfonamide | 1256633-26-7 | 2A-9086389 |
| 2-Chloro-3-nitrobenzonitrile | 34662-24-3 | 2A-9086390 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA