
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70091-75-7 |
| Catalog No. | 2A-9086336 |
| Chinese Name | 4-硝基苯基乙醛酸乙酯 |
| Synonyms | Ethyl 4-nitrophenylglyoxylate; MFCD00051841; Ethyl 4-nitrobenzoylformate |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18200 |
| Density | 1.318g/cm3 |
| Boiling Point | 152-157ºC 0,5mm |
| Melting Point | 40-42ºC |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918300090 |
| SMILES | CCOC(=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI Key | ZFCXKZCKJZFZGR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl3-Chloro-4-fluorobenzoate | 234082-35-0 | 2A-9086330 |
| Ethylalpha-bromolaurate | 6974-87-4 | 2A-9086332 |
| Methyl3-Chloro-4-(4-methylpiperazino)benzoate | 1256633-29-0 | 2A-9086333 |
| 4-Benzoyl-3-methyl-1-phenyl-2-pyrazolin-5-one | 4551-69-3 | 2A-9086334 |
| 2-[[(4-Fluorophenyl)sulfonyl]amino]-2-phenylaceticacid | 117309-49-6 | 2A-9086335 |
| Ethyl3,4,5-trimethoxyphenylpropionate | 70311-20-5 | 2A-9086338 |
| 2-Hydroxy-3-isopropylbenzoicacid | 7053-88-5 | 2A-0201378 |
| 3-Amino-3-cyclohexylpropionicacid | 129042-71-3 | 2A-9086341 |
| Ethyl2-Nitro-4,5-di(1-pyrazolyl)benzoate | 1256633-25-6 | 2A-9086342 |
| Picrolonicacid | 550-74-3 | 2A-9086344 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA