CAS Number610-34-4
Synonymsethyl 2-nitrophenylcarboxylate; Benzoic acid,o-nitro-,ethyl ester; ETHYL-O-NITROBENZOATE; 2-Nitro-benzoesaeure-aethylester; RARECHEM AL BI 0186; 2-nitro-benzoic acid ethyl ester; ethyl-2-nitrobenzoate; MFCD00014696; EINECS 210-220-0
Molecular FormulaC9H9NO4
Molecular Weight195.176
Boiling Point172-174°C 18mm
Melting Point26-30°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-34-4 |
| Catalog No. | 2A-9086269 |
| Chinese Name | 2-硝基苯甲酸乙酯 |
| Synonyms | ethyl 2-nitrophenylcarboxylate; Benzoic acid,o-nitro-,ethyl ester; ETHYL-O-NITROBENZOATE; 2-Nitro-benzoesaeure-aethylester; RARECHEM AL BI 0186; 2-nitro-benzoic acid ethyl ester; ethyl-2-nitrobenzoate; MFCD00014696; EINECS 210-220-0 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.176 |
| Boiling Point | 172-174°C 18mm |
| Melting Point | 26-30°C |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2916399090 |
| MDL Number | MFCD00014696 |
| SMILES | CCOC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| InChI Key | CPNMAYYYYSWTIV-UHFFFAOYSA-N |
| MSDS | msds/86269_1_610_34_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl2-(ethoxycarbonylmethoxy)benzoate | 56424-77-2 | 2A-9086261 |
| Ytterbium(III)OxalateDecahydrate | 51373-68-3 | 2A-9086263 |
| Benzaldiacetate | 581-55-5 | 2A-9086264 |
| Cyclohexylphenylaceticacid | 3894-09-5 | 2A-9086265 |
| Diisopropylthiodiglycolate | 58415-97-7 | 2A-9086268 |
| 1-(4-Nitrophenyl)-3-methyl-5-pyrazolone | 6402-09-1 | 2A-9086270 |
| Ytterbium(III)CarbonateHydrate | 342385-48-2 | 2A-9086271 |
| 4-Pentynoicacid | 6089-09-4 | 2A-9086272 |
| alpha-Phenyl-o-toluicacid | 612-35-1 | 2A-9086273 |
| 3-Phenyl-5-isoxazolone | 1076-59-1 | 2A-9086274 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS