
CAS Number100905-33-7
Synonymsethyl 2-nitro-4,5-dimethoxybenzoate; MFCD00015474; 4,5-dimethoxy-2-nitro-benzoic acid ethyl ester; 2-Nitro-4,5-dimethoxy-benzoesaeure-aethylester; 4,5-Dimethoxy-2-nitro-benzoesaeure-aethylester
Molecular FormulaC11H13NO6
Molecular Weight255.229
Density1.253g/cm3
Boiling Point392.3ºC at 760mmHg
Melting Point100-102ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100905-33-7 |
| Catalog No. | 2A-9086164 |
| Chinese Name | 4,5-二甲氧基-2-硝基苯甲酸乙酯 |
| Synonyms | ethyl 2-nitro-4,5-dimethoxybenzoate; MFCD00015474; 4,5-dimethoxy-2-nitro-benzoic acid ethyl ester; 2-Nitro-4,5-dimethoxy-benzoesaeure-aethylester; 4,5-Dimethoxy-2-nitro-benzoesaeure-aethylester |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.229 |
| Density | 1.253g/cm3 |
| Boiling Point | 392.3ºC at 760mmHg |
| Melting Point | 100-102ºC |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| HTC | 2918990090 |
| MDL Number | MFCD00015474 |
| SMILES | CCOC(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI Key | VNPCXITWHOOQAJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloroacetoxy-2-naphthoicacidanilide | 84522-14-5 | 2A-9086158 |
| Allylstearate | 6289-31-2 | 2A-9086159 |
| Naphtholasbenzoate | 95490-30-5 | 2A-9086160 |
| Naphtholasphenylacetate | 95819-29-7 | 2A-9086161 |
| 3'-Acetoxy-2',4'-dimethoxyacetophenone | 63604-86-4 | 2A-9086162 |
| Ethyl4-(N,N-diethylamino)benzoate | 10287-54-4 | 2A-9086165 |
| 2-(Acetylthio)succinicanhydride | 6953-60-2 | 2A-9086166 |
| 2-Octynoicacidethylester | 10519-20-7 | 2A-9086167 |
| Ethylhydrogenglutarate | 1070-62-8 | 2A-9086168 |
| 4-Dimethylaminobutyricacidhydrochloride | 69954-66-1 | 2A-9086169 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA