
CAS Number27737-55-9
Synonyms4-benzyloxy-1H-indole-2-carboxylic acid ethyl ester; ethyl 4-benzyloxyindole-2-carboxylate; 4-benzyloxy-indole-2-carboxylic acid ethyl ester; EINECS 248-627-0; ethyl 4-benzyloxy-1H-lindole-2-carboxylate
Molecular FormulaC41H45N3O9
Molecular Weight723.83
Density1.225 g/cm3
Boiling Point481.4ºC at 760 mmHg
Melting Point169ºC
AppearanceYellow to light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27737-55-9 |
| Catalog No. | 2A-9086099 |
| Chinese Name | 2-乙酸基-4-苄氧基吲哚 |
| Synonyms | 4-benzyloxy-1H-indole-2-carboxylic acid ethyl ester; ethyl 4-benzyloxyindole-2-carboxylate; 4-benzyloxy-indole-2-carboxylic acid ethyl ester; EINECS 248-627-0; ethyl 4-benzyloxy-1H-lindole-2-carboxylate |
| Molecular Formula | C41H45N3O9 |
| Molecular Weight | 723.83 |
| Density | 1.225 g/cm3 |
| Boiling Point | 481.4ºC at 760 mmHg |
| Melting Point | 169ºC |
| Appearance | Yellow to light brown crystalline powder |
| HTC | 2933990090 |
| MDL Number | MFCD00024521 |
| SMILES | CCOC(=O)c1cc2c(OCc3ccccc3)cccc2[nH]1 |
| InChI | InChI=1S/C18H17NO3/c1-2-21-18(20)16-11-14-15(19-16)9-6-10-17(14)22-12-13-7-4-3-5-8-13/h3-11,19H,2,12H2,1H3 |
| InChI Key | HIQPISGKBJHKIN-UHFFFAOYSA-N |
| MSDS | msds/86099_1_27737_55_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1H-Benzotriazole-6-methanamine | 496841-88-4 | 2A-9086046 |
| MethylTetrazole-1-acetate | 55633-19-7 | 2A-9086048 |
| 2-Hydroxy-6-methoxy-quinoline-4-carboxylicacid | 32431-29-1 | 2A-9086050 |
| Methyl3-pyrrolidine-carboxylatehydrochloride | 198959-34-7 | 2A-9086090 |
| A-Amino-G-(3-indole)butyricacid | 26988-87-4 | 2A-9086097 |
| 3-Benzofuranaceticacid | 64175-51-5 | 2A-9086114 |
| 7-Methoxy-3-phenylsulfonyl-1(3H)-isobenzofuranone | 65131-09-1 | 2A-9086115 |
| 5-Methyl-1-Benzothiophene-2-CarboxylicAcid | 1505-62-0 | 2A-9086122 |
| Ethyl1,2,3-thiadiazole-4-carboxylate | 3989-36-4 | 2A-9086133 |
| Methyl3-Aminothiophene-4-CarboxylateHydrochloride | 39978-14-8 | 2A-9086134 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA