
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2189-26-6 |
| Catalog No. | 2A-9086091 |
| Chinese Name | 甘氨酰-DL-色氨酸 |
| Synonyms | EINECS 218-581-6; Gly-Trp |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.283 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 621.8±55.0 °C at 760 mmHg |
| Appearance | Solid;White to Light yellow to Light red powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2933990090 |
| MDL Number | MFCD00022767 |
| SMILES | NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H15N3O3/c14-6-12(17)16-11(13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6,14H2,(H,16,17)(H,18,19) |
| InChI Key | AJHCSUXXECOXOY-UHFFFAOYSA-N |
| MSDS | msds/86091_1_2189_26_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| PTH-DL-Isoleucine | 5066-94-4 | 2A-9085369 |
| Benzoyl-arginineamidemonohydrochloridemonihydrate | 965-03-7 | 2A-9085494 |
| 4-Borono-DL-phenylalanine | 90580-64-6 | 2A-9085535 |
| N-[[(2,2-dimethyl-5-hexen-1-yl)oxy]carbonyl]-3-methyl-L-Valine | 923591-20-2 | 2A-9085552 |
| 5-Dimethylaminonaphthalene-1-sulfonyl-glycine | 1091-85-6 | 2A-9085892 |
| N-Benzoyl-beta-alanineMethylEster | 89928-06-3 | 2A-9086186 |
| 2-(4-Trifluoromethyl-phenyl)-dl-glycine | 142012-65-5 | 2A-9086378 |
| [1,4]Diazepan-2-one | 99822-50-1 | 2A-9086415 |
| N-Benzoyl-dl-phenylalanine2-naphthylester | 2134-24-9 | 2A-9086514 |
| N-Acetyl-DL-phenylalaninebeta-naphthylester | 20874-31-1 | 2A-9086729 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA