
CAS Number85621-43-8
Synonyms3,4-dihydroxyphenylacetic acid diacetate; 3,4-Diacetoxyphenylacetic acid; EINECS 287-942-8; Diacetylhomoprotocatechusaeure; 2-(3,4-diacetoxyphenyl)acetic acid; [3,4-bis(acetyloxy)phenyl]acetic acid; (3,4-Diacetoxy-phenyl)-essigsaeure
Molecular FormulaC12H12O6
Molecular Weight252.22000
Density1.312g/cm3
Boiling Point390.7ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85621-43-8 |
| Catalog No. | 2A-9086082 |
| Chinese Name | 3,4-二乙酰氧基苯乙酸 |
| Synonyms | 3,4-dihydroxyphenylacetic acid diacetate; 3,4-Diacetoxyphenylacetic acid; EINECS 287-942-8; Diacetylhomoprotocatechusaeure; 2-(3,4-diacetoxyphenyl)acetic acid; [3,4-bis(acetyloxy)phenyl]acetic acid; (3,4-Diacetoxy-phenyl)-essigsaeure |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22000 |
| Density | 1.312g/cm3 |
| Boiling Point | 390.7ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | CC(=O)Oc1ccc(CC(=O)O)cc1OC(C)=O |
| InChI | InChI=1S/C12H12O6/c1-7(13)17-10-4-3-9(6-12(15)16)5-11(10)18-8(2)14/h3-5H,6H2,1-2H3,(H,15,16) |
| InChI Key | VYELVKLTNGETIC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Methylthiobezoyl)propionicacid | 7028-67-3 | 2A-9086076 |
| 4-Acetoxyisophthalicaciddimethylester | 71932-29-1 | 2A-9086077 |
| 2-Acetamido-6-nitrobenzoicacid | 73721-78-5 | 2A-9086078 |
| 3-Carboxyumbelliferylacetate | 81017-23-4 | 2A-9086080 |
| 3-Oxo-4-M-Tolyl-butyricacidethylester | 83823-59-0 | 2A-9086081 |
| Alpha-Acetamido-2-methylcinnamicacid | 88681-64-5 | 2A-9086083 |
| Ethyl4-acetyl-5-oxohexanoate | 2832-10-2 | 2A-9086085 |
| 4-Ethyl-3-nitrobenzoicacid | 103440-95-5 | 2A-9086086 |
| 3,4,5-Trimethylbenzoicacid | 1076-88-6 | 2A-9086087 |
| 3-Propylidenephthalide | 17369-59-4 | 2A-9086088 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA