
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64779-07-3 |
| Catalog No. | 2A-9086075 |
| Chinese Name | 4-氧代-4-(4-戊基苯基)丁酸 |
| Synonyms | hms547a02 |
| Molecular Formula | C22H24BrNO |
| Molecular Weight | 398.347 |
| Density | 1.075g/cm3 |
| Boiling Point | 429.5ºC at 760 mmHg |
| Melting Point | 93ºC |
| HTC | 2918300090 |
| MDL Number | MFCD01912511 |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)O)cc1 |
| InChI Key | MIHIJXVJKUGJED-UHFFFAOYSA-N |
| MSDS | msds/86075_1_64779_07_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl2-nitrobenzoate | 606-27-9 | 2A-9086069 |
| TribromophenylAcetate | 607-95-4 | 2A-9086070 |
| 3-Oxo-4-P-Tolyl-butyricacidethylester | 62135-86-8 | 2A-9086071 |
| Acetyl-2-methylcholinechloride | 62-51-1 | 2A-9086072 |
| Abieticacidethylester | 631-71-0 | 2A-9086074 |
| 3-(4-Methylthiobezoyl)propionicacid | 7028-67-3 | 2A-9086076 |
| 4-Acetoxyisophthalicaciddimethylester | 71932-29-1 | 2A-9086077 |
| 2-Acetamido-6-nitrobenzoicacid | 73721-78-5 | 2A-9086078 |
| 3-Carboxyumbelliferylacetate | 81017-23-4 | 2A-9086080 |
| 3-Oxo-4-M-Tolyl-butyricacidethylester | 83823-59-0 | 2A-9086081 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA