CAS Number59609-59-5
SynonymsMETHYL 3-BROMO-2,4-DIOXO-4-PHENYLBUTANOATE; Benzenebutanoic acid, β-bromo-α,γ-dioxo-, methyl ester; methylbromodioxophenylbutanoate
Molecular FormulaC11H9BrO4
Molecular Weight285.091
Density1.5±0.1 g/cm3
Boiling Point344.4±32.0 °C at 760 mmHg
Melting Point110-112ºC
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59609-59-5 |
| Catalog No. | 2A-9086063 |
| Chinese Name | 甲基3-溴-2,4-二羰基-4-苯基丁酸酯 |
| Synonyms | METHYL 3-BROMO-2,4-DIOXO-4-PHENYLBUTANOATE; Benzenebutanoic acid, β-bromo-α,γ-dioxo-, methyl ester; methylbromodioxophenylbutanoate |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.091 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 344.4±32.0 °C at 760 mmHg |
| Melting Point | 110-112ºC |
| Appearance | White to yellow solid |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| SMILES | COC(=O)C(=O)C(Br)C(=O)c1ccccc1 |
| InChI Key | ZLWZFMIPUOKDJU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Ethyl2-(2,4-Dinitrophenyl)-2-methylpropanoate | 1256633-16-5 | 2A-9085926 |
| 4-(2,4-Dinitrobenzyl)pyridine | 1603-85-6 | 2A-9085948 |
| 2,4-Dichloro-3,5,6-Trimethylpyridine | 109371-17-7 | 2A-9085966 |
| Methyl2,4-dioxo-4-phenylbutanoate | 20577-73-5 | 2A-9086017 |
| 2-[N-(2,4-Dimethylphenyl)carbamoyl]-3-naphthylacetate | 4569-00-0 | 2A-9086057 |
| 2,4-Dimethylbenzoicacidethylester | 33499-42-2 | 2A-9086222 |
| 4-Furan-2-yl-2,4-dioxo-butyricacidmethylester | 374063-90-8 | 2A-9086241 |
| N,N'-Bis(2,4-dinitrophenyl)-4,4'-bipyridiniumdichloride | 41168-79-0 | 2A-9086392 |
| Methyl2,4-dichlorobenzoate | 35112-28-8 | 2A-9086615 |
| 4-(2,4-Dichlorophenyl)thiazole-2-carboxylicAcid | 952959-45-4 | 2A-9086740 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS