CAS Number2905-68-2
Synonymsmethyl ester of 3,4-CBA; 3,4-dichlorobenzoic acid methyl ester; 3,4-Dichlorbenzoesaeure-methylester; MFCD00018165; methyldichlorobenzenecarboxylate; Benzoic acid,4-dichloro-,methyl ester; Benzoic acid,3,4-dichloro-,methyl ester
Molecular FormulaC8H6O2Cl2
Molecular Weight205.04
Density1.355 g/cm3
Boiling Point264ºCat 760 mmHg
Melting Point44 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2905-68-2 |
| Catalog No. | 2A-9086038 |
| Chinese Name | 3,4-二氯苯甲酸甲酯 |
| Synonyms | methyl ester of 3,4-CBA; 3,4-dichlorobenzoic acid methyl ester; 3,4-Dichlorbenzoesaeure-methylester; MFCD00018165; methyldichlorobenzenecarboxylate; Benzoic acid,4-dichloro-,methyl ester; Benzoic acid,3,4-dichloro-,methyl ester |
| Molecular Formula | C8H6O2Cl2 |
| Molecular Weight | 205.04 |
| Density | 1.355 g/cm3 |
| Boiling Point | 264ºCat 760 mmHg |
| Melting Point | 44 °C |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2916399090 |
| MDL Number | MFCD00018165 |
| SMILES | COC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2O2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3 |
| InChI Key | WICGATIORFSOJL-UHFFFAOYSA-N |
| MSDS | msds/86038_1_2905_68_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Didodecylmalonate | 26720-22-9 | 2A-9086032 |
| 3-(Methylsulfonyl)benzylAlcohol | 220798-39-0 | 2A-9086033 |
| N-(2-chloroethyl)-N-methylbenzylamineHydrochloride | 23510-18-1 | 2A-9086034 |
| 2-(Methylsulfonyl)benzylBromide | 82657-74-7 | 2A-9086035 |
| Diethyl2-(3,4-dichlorophenyl)malonate | 28751-26-0 | 2A-9086036 |
| 1-(6-aminopyridin-3-yl)ethanone | 19828-20-7 | 2A-9086039 |
| 3-Methoxypropane-1-sulfonicAcid | 51980-59-7 | 2A-9086041 |
| methyl3-hydroxyisonicotinate | 10128-72-0 | 2A-9086042 |
| Diethyl2,2-diallylmalonate | 3195-24-2 | 2A-9086049 |
| Diethyl2-(3-chloropropyl)-2-ethylmalonate | 32821-60-6 | 2A-9086051 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS