
CAS Number4544-43-8
Synonyms2-Brom-2-<trifluor-acetyl>-essigsaeure-aethylester; Ethyl pound inverted question mark2-Bromo-4,4,4-trifluoro-3-oxobutanoate; PC5768; 2-bromo-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester; ethyl-2-bromo-4,4,4-trifluoro-3-oxobutanoate; Ethyl trifluoroacetylbromoacetate; 2-bromo-4,4,4-trifluoro-3-oxo-butanoic acid,ethyl ester
Molecular FormulaC6H6O3Br1F3
Molecular Weight263.01
Density1.663
Boiling Point199ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4544-43-8 |
| Catalog No. | 2A-9085946 |
| Chinese Name | 2-溴-3-氧代-4,4,4-三氟丁酸乙酯 |
| Synonyms | 2-Brom-2-<trifluor-acetyl>-essigsaeure-aethylester; Ethyl pound inverted question mark2-Bromo-4,4,4-trifluoro-3-oxobutanoate; PC5768; 2-bromo-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester; ethyl-2-bromo-4,4,4-trifluoro-3-oxobutanoate; Ethyl trifluoroacetylbromoacetate; 2-bromo-4,4,4-trifluoro-3-oxo-butanoic acid,ethyl ester |
| Molecular Formula | C6H6O3Br1F3 |
| Molecular Weight | 263.01 |
| Density | 1.663 |
| Boiling Point | 199ºC |
| HTC | 2918300090 |
| MDL Number | MFCD00207670 |
| SMILES | CCOC(=O)C(Br)C(=O)C(F)(F)F |
| InChI Key | ZJTZICBXLSNOHU-UHFFFAOYSA-N |
| MSDS | msds/85946_1_4544_43_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Benzylpiperazino)-5-fluorobenzoicAcid | 1256633-38-1 | 2A-9085938 |
| Methyl2,5-Difluorobenzoate | 362601-90-9 | 2A-9085939 |
| 2-Methyl-2-(5-nitro-2-pyridinyl)propanenitrile | 1256633-31-4 | 2A-9085940 |
| 3-Chloro-4-methoxyanilineHydrochloride | 6329-90-4 | 2A-9085943 |
| 1-(Methoxymethyl)-3-nitrobenzene | 1515-84-0 | 2A-9085944 |
| 2-(Methylsulfonamido)phenylacetonitrile | 36268-70-9 | 2A-9085952 |
| Ethyl2-(Methylsulfonamido)phenylacetate | 36064-30-9 | 2A-9085953 |
| 1-[(3-Nitrobenzyloxy)methyl]pyridiniumchloride | 3009-13-0 | 2A-9085954 |
| D-SerineMethylEster | 24184-43-8 | 2A-9085955 |
| 4-HydroxypicolinicAcidHydrobromide | 125545-96-2 | 2A-9085957 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA