
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1151-97-9 |
| Catalog No. | 2A-9085924 |
| Chinese Name | 2-(2,4-二硝基苯甲基)吡啶 |
| Synonyms | EINECS 214-567-9; MFCD00014632; 2-[(2,4-dinitrophenyl)methyl]pyridine; 2-(2,4-DINITROBENZYL)PYRIDINE |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.223 |
| Density | 1.395g/cm3 |
| Boiling Point | 412.8ºC at 760mmHg |
| Melting Point | 92-94°C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933399090 |
| MDL Number | MFCD00014632 |
| SMILES | O=[N+]([O-])c1ccc(Cc2ccccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N3O4/c16-14(17)11-5-4-9(12(8-11)15(18)19)7-10-3-1-2-6-13-10/h1-6,8H,7H2 |
| InChI Key | KKFNJVINGIUTIH-UHFFFAOYSA-N |
| MSDS | msds/85924_1_1151_97_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(2-Ethoxyethyl)pyridine | 28672-54-0 | 2A-9085890 |
| 3,5-Diethyl-2-N-propylpyridine | 4808-75-7 | 2A-9085897 |
| 2-Ethyl-6-isopropylpyridine | 74701-47-6 | 2A-9085907 |
| 2-Benzyltetrahydropyrrolo[3,4-c]pyrrole-1,3-dione | 86732-32-3 | 2A-9085917 |
| Methyl4-Amino-1-benzylpiperidine-4-carboxylate | 57611-57-1 | 2A-9085921 |
| 2,2'-Vinylenedipyridine | 1437-15-6 | 2A-9085928 |
| 5-Fluoroquinazoline-2,4(1H,3H)-dione | 192570-33-5 | 2A-9085929 |
| 4,4'-Thiodipyridine | 37968-97-1 | 2A-9085933 |
| 4,4'-Ethylenedipyridine | 4916-57-8 | 2A-9085937 |
| 2-Chloro-3,4-DimethoxypyridineHydrochloride | 101664-59-9 | 2A-9085941 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA