CAS Number5413-05-8
Synonyms3-oxo-4-phenyl-butyric acid ethyl ester; ethyl 2-phenyl-3-oxobutanoate; Ethyl 2-phenylacetoacetate; Ethyl acetylphenylacetate; EINECS 226-500-0; Benzenebutanoic acid, β-oxo-, ethyl ester; MFCD00040490; 3-oxo-2-phenylbutyric acid ethyl ester; ethyl 2-phenyl-acetoacetate; 2-fenil-3-oxobutanoato di etile; Ethyl 3-oxo-4-phenylbutanoate
Molecular FormulaC12H14O3
Molecular Weight206.238
Density1.1±0.1 g/cm3
Boiling Point290.3±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5413-05-8 |
| Catalog No. | 2A-9085883 |
| Chinese Name | 2-苯基乙酰乙酸乙酯 |
| Synonyms | 3-oxo-4-phenyl-butyric acid ethyl ester; ethyl 2-phenyl-3-oxobutanoate; Ethyl 2-phenylacetoacetate; Ethyl acetylphenylacetate; EINECS 226-500-0; Benzenebutanoic acid, β-oxo-, ethyl ester; MFCD00040490; 3-oxo-2-phenylbutyric acid ethyl ester; ethyl 2-phenyl-acetoacetate; 2-fenil-3-oxobutanoato di etile; Ethyl 3-oxo-4-phenylbutanoate |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 290.3±15.0 °C at 760 mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2918300090 |
| SMILES | CCOC(=O)C(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3 |
| InChI Key | PWRUKIPYVGHRFL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Pyridyl)-2-propylamineDihydrochloride | 1256633-17-6 | 2A-9085876 |
| 2-Chloro-5-sulfamoylbenzoicacid | 97-04-1 | 2A-9085877 |
| 2-(2-Pyrrolyl)ethylamineHydrochloride | 857418-70-3 | 2A-9085878 |
| 1-(2-Pyridyl)cyclopropylamineDihydrochloride | 1215107-39-3 | 2A-9085880 |
| 3-Phenylphthalide | 5398-11-8 | 2A-9085881 |
| Methyl4-Bromo-2-nitrobenzoate | 158580-57-5 | 2A-9085884 |
| DL-1,1'-Bi(2-Naphthyldiacetate) | 100569-82-2 | 2A-9085886 |
| Diethyl(benzotriazol-1-yl)iminomalonate | 100796-79-0 | 2A-9085888 |
| 4-Phenylbutyrolactone | 1008-76-0 | 2A-9085889 |
| PropylphosphonicAnhydrideSolution,50%inEthylAcetate | 68957-94-8 | 2A-9085891 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS