
CAS Number1475-13-4
Synonyms2,4-Dichloro-α-methylbenzyl alcohol; UNII:D44O14048Q; 1-(2,4-Dichlorophenyl)ethyl Alcohol; 2,4-Dichloro-alpha-methylbenzyl alcohol; 1-(2,4-Dichlorophenyl)ethanol
Molecular FormulaC8H8Cl2O
Molecular Weight191.058
Density1.3±0.1 g/cm3
Boiling Point270.7±25.0 °C at 760 mmHg
AppearanceLiquid | Clear colorless
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1475-13-4 |
| Catalog No. | 2A-9085822 |
| Chinese Name | 1-(2,4-二氯苯基)乙醇 |
| Synonyms | 2,4-Dichloro-α-methylbenzyl alcohol; UNII:D44O14048Q; 1-(2,4-Dichlorophenyl)ethyl Alcohol; 2,4-Dichloro-alpha-methylbenzyl alcohol; 1-(2,4-Dichlorophenyl)ethanol |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.058 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 270.7±25.0 °C at 760 mmHg |
| Appearance | Liquid | Clear colorless |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906299090 |
| MDL Number | MFCD00004511 |
| SMILES | CC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5,11H,1H3 |
| InChI Key | KWZDYNBHZMQRLS-UHFFFAOYSA-N |
| MSDS | msds/85822_1_1475_13_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Difluorobenzoylacetonitrile | 71682-95-6 | 2A-9085599 |
| 2,4-DihydroxyquinolineMonosodiumsalt | 4510-76-3 | 2A-9085655 |
| 2,4,5-Trifluorobenzoylchloride | 88419-56-1 | 2A-9085662 |
| 3-Iodo-2,4,5-trimethylthiophene | 60813-84-5 | 2A-9085722 |
| 2,4-Difluoro-1-methoxybenzene | 252-10-8 | 2A-9085729 |
| 1-(2,4-Diethoxyphenyl)ethanol | 1141669-81-9 | 2A-9085829 |
| 3,6-Dimethyl-2,4-dinitrophenol | 15968-56-6 | 2A-9085860 |
| Ethyl2-(2,4-Dinitrophenyl)-2-methylpropanoate | 1256633-16-5 | 2A-9085926 |
| 4-(2,4-Dinitrobenzyl)pyridine | 1603-85-6 | 2A-9085948 |
| 2,4-Dichloro-3,5,6-Trimethylpyridine | 109371-17-7 | 2A-9085966 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA