
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79-91-4 |
| Catalog No. | 2A-9085777 |
| Chinese Name | 芸香酸 |
| Synonyms | 2,2-dimethyl-5-oxooxolane-3-carboxylic acid; EINECS 201-233-2 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15200 |
| Boiling Point | 347.6ºC at 760 mmHg |
| Melting Point | 175ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2932190090 |
| SMILES | CC1(C)OC(=O)CC1C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m1/s1 |
| InChI Key | UZBOWOQARWWIER-UHFFFAOYSA-N |
| MSDS | msds/85777_1_79_91_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified Rutamic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methylcyclopropylcarbamate | 73330-91-3 | 2A-9085767 |
| 7-Fluoro-4-methylisatin | 749240-53-7 | 2A-9085769 |
| Methylheptafluoroisobutyrate | 680-05-7 | 2A-9085770 |
| 7-Fluoro-5-methylisatin | 442910-92-1 | 2A-9085773 |
| Phthalicacidmono-n-butylester | 131-70-4 | 2A-9085775 |
| Terephthalicacid2-hydroxyethylmethylester | 3645-00-9 | 2A-9085779 |
| 3,4-Difluoro-6-nitrophenol | 55346-97-9 | 2A-9085780 |
| Terephthalicacidmono(2-bromoethyl)ester | 173550-97-5 | 2A-9085781 |
| Tetrabromophthalicacid | 13810-83-8 | 2A-9085783 |
| 3,5-Difluoro-2-nitrophenol | 151414-46-9 | 2A-9085784 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA