
CAS Number13365-26-9
Synonymsdimethyl 3-nitro-phthalate; Dimethyl 3-nitrophthalate; HMS542N19; 3-Nitro-phthalsaeure-dimethylester; MFCD00017184; 3-nitrophthalic acid dimethyl ester
Molecular FormulaC10H9NO6
Molecular Weight239.186
Density1.35g/cm3
Boiling Point314.6ºC at 760mmHg
Melting Point68-69°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13365-26-9 |
| Catalog No. | 2A-9085759 |
| Chinese Name | 3-硝基邻苯二甲酸二甲酯 |
| Synonyms | dimethyl 3-nitro-phthalate; Dimethyl 3-nitrophthalate; HMS542N19; 3-Nitro-phthalsaeure-dimethylester; MFCD00017184; 3-nitrophthalic acid dimethyl ester |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.186 |
| Density | 1.35g/cm3 |
| Boiling Point | 314.6ºC at 760mmHg |
| Melting Point | 68-69°C |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2917399090 |
| MDL Number | MFCD00017184 |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1C(=O)OC |
| InChI | InChI=1S/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| InChI Key | MLQMIKSBTAZNBK-UHFFFAOYSA-N |
| MSDS | msds/85759_1_13365_26_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Ethylquinoliniumiodide | 634-35-5 | 2A-9085749 |
| 2,3-Difluoro-5-methylbenzonitrile | 1003712-18-2 | 2A-9085750 |
| 2,5-Difluoro-3-methylbenzonitrile | 1003712-20-6 | 2A-9085752 |
| 2,5-Difluoro-4-methylbenzonitrile | 1003708-66-4 | 2A-9085756 |
| Thiazolidine-2-carboxylicacid | 65126-70-7 | 2A-9085757 |
| 3,5-Difluoro-2-methylbenzonitrile | 1003708-74-4 | 2A-9085760 |
| Di-n-pentylphthalate | 131-18-0 | 2A-9085763 |
| 4,5-Difluoro-2-methylbenzonitrile | 1003708-82-4 | 2A-9085764 |
| Dipropylphthalate | 131-16-8 | 2A-9085765 |
| Methylcyclopropylcarbamate | 73330-91-3 | 2A-9085767 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA