
CAS Number1551-43-5
SynonymsValeriansaeurecyclohexylester; valeric acid cyclohexyl ester; MFCD00046355; Cyclohexyl valerate; propyl cyclo hexyl acetate; 1-Cyclohexyl pentanoate; Cyclohexyl n-valerate; Pentanoic acid,cyclohexyl ester
Molecular FormulaC11H20O2
Molecular Weight184.28
Density0.94 g/cm3
Boiling Point232.2ºC at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1551-43-5 |
| Catalog No. | 2A-9085741 |
| Chinese Name | 戊酸环己基酯 |
| Synonyms | Valeriansaeurecyclohexylester; valeric acid cyclohexyl ester; MFCD00046355; Cyclohexyl valerate; propyl cyclo hexyl acetate; 1-Cyclohexyl pentanoate; Cyclohexyl n-valerate; Pentanoic acid,cyclohexyl ester |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| Density | 0.94 g/cm3 |
| Boiling Point | 232.2ºC at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2915600000 |
| MDL Number | MFCD00046355 |
| SMILES | CCCCC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C11H20O2/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h10H,2-9H2,1H3 |
| InChI Key | YLCHTSSXNSNXSW-UHFFFAOYSA-N |
| MSDS | msds/85741_1_1551_43_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2915600000 butanoic acids and pentanoic acids and their salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Hydroxynaphthalimidesodiumsalt | 6207-89-2 | 2A-9085733 |
| 5-Amino-2-methylbenzotrifluoride | 65934-79-9 | 2A-9085735 |
| 4-Bromo-2-fluorocinnamicacid | 14994-19-3 | 2A-9085737 |
| 3-(Trifluoromethoxy)benzylchloride | 89807-43-2 | 2A-9085739 |
| 2-Bromo-3,4-difluoronitrobenzene | 350699-92-2 | 2A-9085740 |
| Cyclohexylglycolicacid | 53585-93-6 | 2A-9085742 |
| 2,3-Difluoro-5-methylbenzoicacid | 1003709-96-3 | 2A-9085743 |
| Dibenzylphthalate | 523-31-9 | 2A-9085744 |
| 2,5-Difluoro-3-methylbenzoicacid | 1003710-01-7 | 2A-9085745 |
| 3,5-Difluoro-2-methylbenzoicacid | 1003710-06-2 | 2A-9085748 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA