
CAS Number613-21-8
Synonyms2-methyl-quinolin-6-ol; 6-hydroxy-2-methylquinoline; 6-hydroxy-2-quinaldine; 2-Methyl-6-hydroxyquinoline; 6-hydroxyquinaldine; 2-methyl-6-hydroxy-quinoline; 6-Quinolinol,2-methyl; 2-methylquinolin-6-ol; MFCD00047600; 2-Methyl-6-quinolinol
Molecular FormulaC10H9NO
Molecular Weight159.185
Density1.2±0.1 g/cm3
Boiling Point304.5±0.0 °C at 760 mmHg
Melting Point58-61°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-21-8 |
| Catalog No. | 2A-9085724 |
| Chinese Name | 6-羟基-2-甲基喹啉 |
| Synonyms | 2-methyl-quinolin-6-ol; 6-hydroxy-2-methylquinoline; 6-hydroxy-2-quinaldine; 2-Methyl-6-hydroxyquinoline; 6-hydroxyquinaldine; 2-methyl-6-hydroxy-quinoline; 6-Quinolinol,2-methyl; 2-methylquinolin-6-ol; MFCD00047600; 2-Methyl-6-quinolinol |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.185 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 304.5±0.0 °C at 760 mmHg |
| Melting Point | 58-61°C |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2933499090 |
| SMILES | Cc1ccc2cc(O)ccc2n1 |
| InChI | InChI=1S/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| InChI Key | USSQQASIZNTRAJ-UHFFFAOYSA-N |
| MSDS | msds/85724_1_613_21_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-(3-Thienyl)Tthiophene-2-CarboxylicAcid | 60141-31-3 | 2A-9085706 |
| 5-(Methylsulfonyl)thiophene-2-carboxylicacid | 60166-86-1 | 2A-9085711 |
| 4-Methylthiophene-2-carboxaldehyde | 6030-36-0 | 2A-9085716 |
| 2-(2-Chloro-Acetylamino)-4,5-Dimethyl-Thiophene-3-CarboxylicAcidEthylEster | 60442-34-4 | 2A-9085719 |
| 5-Bromo-2,3-dihydrobenzofuran-7-carboxylicacid | 41177-72-4 | 2A-9085720 |
| 2-Chloro-3-nitrothiophene-5-sulfonamide | 61714-46-3 | 2A-9085731 |
| Methyl3-methoxythiophene-2-carboxylate | 62353-75-7 | 2A-9085734 |
| 5-(Phenylthio)thiophene-2-sulfonamide | 63031-79-8 | 2A-9085736 |
| 5-[(4-Chlorophenyl)Thio]Thiophene-2-Sulfonamide | 63031-81-2 | 2A-9085738 |
| 5-(2-Thienylthio)Thiophene-2-Sulfnamide | 63033-64-7 | 2A-9085746 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA