
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-08-1 |
| Catalog No. | 2A-9085688 |
| Chinese Name | 2-蒽甲酸 |
| Synonyms | MFCD00142865; anthracene-2-carboxylic acid |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 |
| Density | 1.305g/cm3 |
| Boiling Point | 435.4ºC at 760 mmHg |
| Melting Point | 289 °C |
| Appearance | Solid;Light yellow to Yellow to Green powder to crystal |
| Water Solubility | Soluble in: dimethylformamide |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2916399090 |
| MDL Number | MFCD00142865 |
| SMILES | O=C(O)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H10O2/c16-15(17)13-6-5-12-7-10-3-1-2-4-11(10)8-14(12)9-13/h1-9H,(H,16,17) |
| InChI Key | RZRJYURCNBXIST-UHFFFAOYSA-N |
| MSDS | msds/85688_1_613_08_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 2-Anthracenecarboxylic acid Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Methoxyphenyl)-1-cyclopropanecarboxylicacid | 16728-01-1 | 2A-9085675 |
| 1-Anthracenecarboxylicacid | 607-42-1 | 2A-9085676 |
| 3-Fluorobenzylcyanide | 10036-43-8 | 2A-9085679 |
| 2-(4-Oxo-3,4-dihydrophthalazin-1-yl)aceticacid | 25947-11-9 | 2A-9085680 |
| 2,2-Dichloro-1-methylcyclopropanecarboxylicacid | 1447-14-9 | 2A-9085685 |
| 2-Furoylacetonitrile | 31909-58-7 | 2A-9085689 |
| 2-Chloro-3,4-dimethoxycinnamicacid | 99854-17-8 | 2A-9085690 |
| 2-(2,2,4,7-Tetramethyl-1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-ol | 53817-44-0 | 2A-9085691 |
| 2-Chloro-1-fluoro-4-methylbenzene | 1523-25-3 | 2A-9085692 |
| 2-Sulfoterephthalicacidmonosodiumsalt | 19089-60-2 | 2A-9085694 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA