
CAS Number51049-14-0
Synonyms6,8-dimethoxy-4-methyl-quinoline; 6,8-DIMETHOXY-4-METHYLQUINOLINE; 6,8-DiMethoxy-4-Methylquinoline Hydrate; D2190
Molecular FormulaC12H13NO2
Molecular Weight237.68
Density1.1±0.1 g/cm3
Boiling Point346.4±37.0 °C at 760 mmHg
Melting Point65ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51049-14-0 |
| Catalog No. | 2A-9085681 |
| Chinese Name | 6,8-二甲氧基-4-甲基喹啉水合物 |
| Synonyms | 6,8-dimethoxy-4-methyl-quinoline; 6,8-DIMETHOXY-4-METHYLQUINOLINE; 6,8-DiMethoxy-4-Methylquinoline Hydrate; D2190 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 237.68 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 346.4±37.0 °C at 760 mmHg |
| Melting Point | 65ºC |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933499090 |
| PubChem ID | 329775855 |
| MDL Number | MFCD06668102 |
| SMILES | ClC1=NC2=C(OC)C=CC(OC)=C2C(C)=C1 |
| InChI | 1S/C12H12ClNO2/c1-7-6-10(13)14-12-9(16-3)5-4-8(15-2)11(7)12/h4-6H,1-3H3 |
| InChI Key | SVTDGXZOUFALGO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85681_1_51049_14_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,5-Dihydronaphtho[1,2]Thiophene-2-CarboxylicAcid | 29179-41-7 | 2A-9085671 |
| 2-(Chloroacetyl)thiophene | 29683-77-0 | 2A-9085673 |
| Ethyl7-methoxybenzofuran-2-carboxylate | 50551-58-1 | 2A-9085674 |
| 1-Ethyl-3-methyl-1H-pyrazole-5-carboxylicacid | 50920-65-5 | 2A-9085677 |
| 2-[(4-Chlorophenyl)thio]thiophene-3-carbaldehyde | 306935-23-9 | 2A-9085678 |
| 2-OctanoylThiophene | 30711-41-2 | 2A-9085682 |
| QuinolineHydrochloride | 530-64-3 | 2A-9085684 |
| Ethyl6-Fluoro-4-Hydroxy-3-Quinolinecarboxylate | 318-35-4 | 2A-9085686 |
| N'-Hydroxy-2-thiophenecarboximidamide | 53370-51-7 | 2A-9085687 |
| 4-Chloro-2,8-Dimethylquinoline | 32314-39-9 | 2A-9085693 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA