
CAS Number1082-85-5
Synonyms1-(4-acetylphenyl)pyrrole-2,5-dione; 1-(4-Acetylphenyl)-1H-pyrrole-2,5-dione; MFCD00014537; EINECS 214-106-1; 1-(4-acetylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione; N-(4-Acetylphenyl)maleimide
Molecular FormulaC12H9O3N1
Molecular Weight215.21
Density1.3±0.1 g/cm3
Boiling Point403.6±28.0 °C at 760 mmHg
Melting Point153-156 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1082-85-5 |
| Catalog No. | 2A-9085551 |
| Chinese Name | N-(4-乙酰苯)马来酰胺 |
| Synonyms | 1-(4-acetylphenyl)pyrrole-2,5-dione; 1-(4-Acetylphenyl)-1H-pyrrole-2,5-dione; MFCD00014537; EINECS 214-106-1; 1-(4-acetylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione; N-(4-Acetylphenyl)maleimide |
| Molecular Formula | C12H9O3N1 |
| Molecular Weight | 215.21 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 403.6±28.0 °C at 760 mmHg |
| Melting Point | 153-156 °C |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2925190090 |
| MDL Number | MFCD00014537 |
| SMILES | CC(=O)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C12H9NO3/c1-8(14)9-2-4-10(5-3-9)13-11(15)6-7-12(13)16/h2-7H,1H3 |
| InChI Key | ISGBKWSEHGAUNF-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/85551_1_1082_85_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Amino-5-pyridin-4-yl-4H-[1,2,4]triazole-3-thiol | 36209-51-5 | 2A-9085532 |
| 1-Phenyl-6,7-Dimethoxy-3,4-Dihydroisoquinoline | 10172-39-1 | 2A-9085542 |
| 3-N-Pentylthiophene | 102871-31-8 | 2A-9085543 |
| 4-Bromo-1-ethyl-1H-pyrazole | 71229-85-1 | 2A-9085546 |
| 3-N-Octadecylthiophene | 104934-54-5 | 2A-9085547 |
| Methyl2-piperazineacetate2HCl | 394709-83-2 | 2A-9085553 |
| 2-Butyl-5-methylthiophene | 111510-96-4 | 2A-9085554 |
| 2-Bromo-5-Methyl-1-Benzothiophene | 111860-00-5 | 2A-9085557 |
| 2-Phenyl-1,3-dioxolane | 936-51-6 | 2A-9085558 |
| Methyl1,2,3-benzotriazole-5-carboxylate | 113053-50-2 | 2A-9085561 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA