
CAS Number1947-47-3
Synonyms3-amino-2-phenyl-1-inden-1-one; 3-Amino-2-phenylindenone; 3-Amino-2-phenyl-inden-1-on; 3-amino-2-phenylindan-1-one; 3-amino-2-phenyl-inden-1-one; MFCD00051614; 3-Amino-2-phenyl-1H-inden-1-one
Molecular FormulaC15H11NO
Molecular Weight187.24
Density1.256g/cm3
Boiling Point405.1ºC at 760mmHg
Melting Point271-273°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1947-47-3 |
| Catalog No. | 2A-9085531 |
| Chinese Name | 3-氨基-2-苯基二氢印酮 |
| Synonyms | 3-amino-2-phenyl-1-inden-1-one; 3-Amino-2-phenylindenone; 3-Amino-2-phenyl-inden-1-on; 3-amino-2-phenylindan-1-one; 3-amino-2-phenyl-inden-1-one; MFCD00051614; 3-Amino-2-phenyl-1H-inden-1-one |
| Molecular Formula | C15H11NO |
| Molecular Weight | 187.24 |
| Density | 1.256g/cm3 |
| Boiling Point | 405.1ºC at 760mmHg |
| Melting Point | 271-273°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2922399090 |
| SMILES | NC1=C(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9H,16H2 |
| InChI Key | HLEKBTIHDXNOQP-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85531_1_1947_47_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Amino-1-phenalenone | 70402-14-1 | 2A-9085521 |
| 3-Phenyl-1,2,4-thiadiazol-5-amine | 17467-15-1 | 2A-9085522 |
| 2-Iodofluorobenzene | 348-52-8 | 2A-9085526 |
| 3-Iodofluorobenzene | 1121-88-4 | 2A-9085527 |
| 2-Fluoro-4-bromobenzotrifluoride | 142808-15-8 | 2A-9085528 |
| 2-Chloro-5-bromobenzotrifluoride | 455-01-2 | 2A-9085533 |
| 2-(Trifluoromethoxy)aminobenzene | 1535-35-7 | 2A-9085536 |
| 4-Borono-D-phenylalanine | 111821-49-9 | 2A-9085537 |
| 4-Chloro-3-nitroanisole | 10289-80-3 | 2A-9085538 |
| 5-alpha-Thenil | 7333-07-5 | 2A-9085539 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA