
CAS Number67676-47-5
SynonymsN-ethyl-N-benzyl-4-amino benzaldehyde; 4-N-benzylamino-N-ethylaminobenzaldehyde; MFCD03147226; 4-[Benzyl(ethyl)amino]benzaldehyde; 4-(Benzyl-ethyl-amino)-benzaldehyde
Molecular Formula(NCCH2CH2)(C2H5)NC6H3(CH3)CHO
Molecular Weight216.28
Purity98%
Density1.1±0.1 g/cm3
Boiling Point404.0±38.0 °C at 760 mmHg
Melting Point64-67 °C (lit.)
EINECS204-362-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67676-47-5 |
| Catalog No. | 2A-9008550 |
| Chinese Name | N-乙基-N-苄基-4-氨基苯甲醛 |
| Synonyms | N-ethyl-N-benzyl-4-amino benzaldehyde; 4-N-benzylamino-N-ethylaminobenzaldehyde; MFCD03147226; 4-[Benzyl(ethyl)amino]benzaldehyde; 4-(Benzyl-ethyl-amino)-benzaldehyde |
| Molecular Formula | (NCCH2CH2)(C2H5)NC6H3(CH3)CHO |
| Molecular Weight | 216.28 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 404.0±38.0 °C at 760 mmHg |
| Melting Point | 64-67 °C (lit.) |
| EINECS | 204-362-2 |
| HTC | 2922399090 |
| PubChem ID | 24877577 |
| MDL Number | MFCD02683509 |
| SMILES | CCN(CCC#N)c1ccc(C=O)c(C)c1 |
| InChI | 1S/C13H16N2O/c1-3-15(8-4-7-14)13-6-5-12(10-16)11(2)9-13/h5-6,9-10H,3-4,8H2,1-2H3 |
| InChI Key | VTXVKMVZEXXUIC-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| N-Benzylaminoacetaldehyde diethyl acetal | 61190-10-1 | 2A-9008487 |
| n-Butylboronic acid | 4426-47-5 | 2A-9008514 |
| N-Chloroacetyl-2-(trifluoromethyl)aniline | 3792-04-9 | 2A-9008522 |
| N-Chloroacetyl-3-(trifluoromethyl)aniline | 351-38-2 | 2A-9008524 |
| N-Chloroacetyl-4-(trifluoromethyl)aniline | 2707-23-5 | 2A-9008526 |
| N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde | 1201-91-8 | 2A-9008592 |
| o-Anisaldehyde | 135-02-4 | 2A-0200578 |
| Orotalaldehyde | 36327-91-0 | 2A-9008633 |
| Phenyl trifluoromethyl sulfide | 456-56-4 | 2A-9008665 |
| Phenylboronic acid | 98-80-6 | 2A-9008669 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA