
CAS Number32953-14-3
SynonymsN-ethylbenzo[d][1,3]dioxol-5-amine; N-Ethyl-3,4-methylenedioxyaniline; N-Ethyl-3,4-(methylenedioxy)aniline; benzo[1,3]dioxol-5-yl(ethyl)amine; 1,3-Benzodioxol-5-amine,N-ethyl; 3,4-Methylenedioxy-N-ethylaniline; 5-(Ethylamino)-1,3-benzodioxole; N-ethylbenzo-1,3-dioxol-5-amine; 3,4-Methylenedioxyphenylethylamine; EINECS 251-302-6; MFCD00009743
Molecular FormulaC9H11NO2
Molecular Weight165.194
Purity98%
Density1,17 g/cm3
Boiling Point101-103 °C (1 mmHg)
AppearanceTransparent colorless to light yellow viscous liquid
EINECS251-302-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32953-14-3 |
| Catalog No. | 2A-9008541 |
| Chinese Name | 3,4-亚甲二氧基-N-乙基苯胺 |
| Synonyms | N-ethylbenzo[d][1,3]dioxol-5-amine; N-Ethyl-3,4-methylenedioxyaniline; N-Ethyl-3,4-(methylenedioxy)aniline; benzo[1,3]dioxol-5-yl(ethyl)amine; 1,3-Benzodioxol-5-amine,N-ethyl; 3,4-Methylenedioxy-N-ethylaniline; 5-(Ethylamino)-1,3-benzodioxole; N-ethylbenzo-1,3-dioxol-5-amine; 3,4-Methylenedioxyphenylethylamine; EINECS 251-302-6; MFCD00009743 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.194 |
| Purity | 98 |
| Density | 1,17 g/cm3 |
| Boiling Point | 101-103 °C (1 mmHg) |
| Appearance | Transparent colorless to light yellow viscous liquid |
| Water Solubility | slightly miscible |
| Storage Condition | Room temperature, dry, inert gas storage |
| EINECS | 251-302-6 |
| HTC | 2932999099 |
| MDL Number | MFCD00009743 |
| SMILES | CCNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11NO2/c1-2-10-7-3-4-8-9(5-7)12-6-11-8/h3-5,10H,2,6H2,1H3 |
| InChI Key | FPKGTVXPIULTIP-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Dansyl-D-Ala-Gly-4-nitro-Phe-Gly | 83960-27-4 | 2A-9008531 |
| Neodecanoyl chloride | 40292-82-8 | 2A-9008534 |
| Neopentylamine | 5813-64-9 | 2A-9008537 |
| N-epsilon-carbobenzyloxy-L-lysine | 1155-64-2 | 2A-9008539 |
| N-Ethyl perfluorooctanesulphonamide | 4151-50-2 | 2A-9008540 |
| N-Ethyl-3-cyano-6-hydroxy-4-methyl-2-pyridone | 6639-38-4 | 2A-9008545 |
| N-Ethylethylenediamine | 110-72-5 | 2A-9008547 |
| N-Ethyl-N-3-((3-dimethylamino-1-oxo-2-propenyl)phenyl)acetamide | 96605-66-2 | 2A-9008549 |
| N-Ethyl-N-hydroxyphthalamide | 2A-108551 | 2A-9008551 |
| n-Heptyl 4-hydroxybenzoate | 1085-12-7 | 2A-9008556 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA