
CAS Number28128-40-7
Synonyms8-MERCAPTOGUANINE; 8-THIOGUANINE; 2-Amino-8-thioxo-1,7,8,9-tetrahydro-6H-purin-6-one; MFCD00075623; 2-AMINO-6-HYDROXY-8-THIOPURINE; 2-Amino-8-sulfanyl-9H-purin-6-ol; 2-amino-8-mercapto-9H-purin-6-ol; 2-Amino-8-thioxo-3,7,8,9-tetrahydro-6H-purin-6-one
Molecular FormulaC10H12O4N5Br1
Molecular Weight346.14
Density1.9±0.1 g/cm3
Boiling Point637.3±65.0 °C at 760 mmHg
Melting Point300 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28128-40-7 |
| Catalog No. | 2A-9085401 |
| Chinese Name | 2-氨基-6-羟基-8-巯基嘌呤 |
| Synonyms | 8-MERCAPTOGUANINE; 8-THIOGUANINE; 2-Amino-8-thioxo-1,7,8,9-tetrahydro-6H-purin-6-one; MFCD00075623; 2-AMINO-6-HYDROXY-8-THIOPURINE; 2-Amino-8-sulfanyl-9H-purin-6-ol; 2-amino-8-mercapto-9H-purin-6-ol; 2-Amino-8-thioxo-3,7,8,9-tetrahydro-6H-purin-6-one |
| Molecular Formula | C10H12O4N5Br1 |
| Molecular Weight | 346.14 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 637.3±65.0 °C at 760 mmHg |
| Melting Point | 300 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| MDL Number | MFCD01630971 |
| SMILES | NC1=NC(=O)C2=C(N1)NC(=S)N2 |
| InChI | InChI=1S/C5H5N5OS/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H5,6,7,8,9,10,11,12) |
| InChI Key | InChIKey=JHEKNTQSGTVPAO-UHFFFAOYSA-N |
| MSDS | msds/85401_1_28128_40_7.pdf |
| Transport Info | Product name: 2-amino-6-hydroxy-8-mercaptopurine |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-5,6-dimethylbenzothiazole | 29927-08-0 | 2A-9085392 |
| 3-Amino-5,6-diphenyl-1,2,4-triazine | 4511-99-3 | 2A-9085396 |
| 2-Amino-3-ethyl-6-methylpyridine | 41995-31-7 | 2A-9085397 |
| 2-Amino-6-ethylpyridine | 21717-29-3 | 2A-9085398 |
| 2-Amino-9H-pyrido[2,3-B]indole | 26148-68-5 | 2A-9085400 |
| 1-Amino-4-(2-hydroxyethyl)piperazine | 3973-70-4 | 2A-9085403 |
| 6-Amino-2-benzothiazole-thiol | 7442-07-1 | 2A-9085407 |
| 2-Amino-4-methoxy-6-methylthio-S-triazine | 30358-18-0 | 2A-9085409 |
| N-Fluoroperfluoropiperidine | 836-77-1 | 2A-9085430 |
| 1-(4-Chlorophenylmethyl)-2-aminobenzimidazole | 109635-38-3 | 2A-9085453 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA