
CAS Number1942-31-0
Synonyms1-acetyl-4-(2-phenylethynyl)benzene; 4-(1-oxoethyl)-1-(phenylethynyl)benzene; 1-(4-acetylphenyl)-2-phenylethyne; 1-(4-(2-phenylethynyl)phenyl)ethanone; MFCD00219774; 1-(4-(2-phenylethynyl)phenyl)ethan-1-one; 1-[4-(2-phenyleth-1-ynyl)phenyl]ethan-1-one; 4-acetylphenyl(phenyl)acetylene
Molecular FormulaC16H12O
Molecular Weight220.27
Density1.12g/cm3
Boiling Point377.2ºC at 760mmHg
Melting Point99 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1942-31-0 |
| Catalog No. | 2A-9085349 |
| Chinese Name | 4-苯乙炔基苯乙酮 |
| Synonyms | 1-acetyl-4-(2-phenylethynyl)benzene; 4-(1-oxoethyl)-1-(phenylethynyl)benzene; 1-(4-acetylphenyl)-2-phenylethyne; 1-(4-(2-phenylethynyl)phenyl)ethanone; MFCD00219774; 1-(4-(2-phenylethynyl)phenyl)ethan-1-one; 1-[4-(2-phenyleth-1-ynyl)phenyl]ethan-1-one; 4-acetylphenyl(phenyl)acetylene |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 |
| Density | 1.12g/cm3 |
| Boiling Point | 377.2ºC at 760mmHg |
| Melting Point | 99 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914399090 |
| PubChem ID | 329777999 |
| MDL Number | MFCD00219774 |
| SMILES | CC(=O)c1ccc(cc1)C#Cc2ccccc2 |
| InChI | 1S/C16H12O/c1-13(17)16-11-9-15(10-12-16)8-7-14-5-3-2-4-6-14/h2-6,9-12H,1H3 |
| InChI Key | QCYZMMVPXNWSJK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85349_1_1942_31_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PTH-4-Hydroxyproline | 81703-65-3 | 2A-9085341 |
| Bis(4-Methoxyphenyl)phenylphosphine | 14180-51-9 | 2A-9085342 |
| 2,4,6-Trimethoxynitrobenzene | 14227-18-0 | 2A-9085343 |
| MTH-DL-Methionine | 877-49-6 | 2A-9085346 |
| 4-(4-Propyl-cyclohexyl)-phenylacetylene | 167858-58-4 | 2A-9085348 |
| 2,3-Dimethylacetophenone | 2142-71-4 | 2A-9085350 |
| 2,6-Dimethylacetophenone | 2142-76-9 | 2A-9085351 |
| 4'-Dodecyloxyacetophenone | 2175-80-6 | 2A-9085354 |
| 4'-Octyloxyacetophenone | 37062-63-8 | 2A-9085357 |
| PTH-(S-Phenylthiocarbamyl)cysteine | 4094-50-2 | 2A-9085358 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA