CAS Number609-21-2
Synonyms4-amino-2,6-dibromo-phenol; EINECS 210-185-1; MFCD00007874; 4-AMINO-2,6-DIBROMOPHENOL; 2,6-Dibromo-4-aminophenol; 4-hydroxy-3,5-dibromoaniline; 4-Amino-2,6-dibrom-phenol; 3,5-Dibromo-4-hydroxyaniline; Phenol,4-amino-2,6-dibromo
Molecular FormulaC6H5Br2NO
Molecular Weight266.918
Density2.2±0.1 g/cm3
Boiling Point295.6±40.0 °C at 760 mmHg
Melting Point195-196 °C(lit.)
AppearanceBeige to light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 609-21-2 |
| Catalog No. | 2A-9085331 |
| Chinese Name | 4-氨基-2,6-二溴苯酚 |
| Synonyms | 4-amino-2,6-dibromo-phenol; EINECS 210-185-1; MFCD00007874; 4-AMINO-2,6-DIBROMOPHENOL; 2,6-Dibromo-4-aminophenol; 4-hydroxy-3,5-dibromoaniline; 4-Amino-2,6-dibrom-phenol; 3,5-Dibromo-4-hydroxyaniline; Phenol,4-amino-2,6-dibromo |
| Molecular Formula | C6H5Br2NO |
| Molecular Weight | 266.918 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 295.6±40.0 °C at 760 mmHg |
| Melting Point | 195-196 °C(lit.) |
| Appearance | Beige to light brown crystalline powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2922299090 |
| SMILES | Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C6H5Br2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| InChI Key | HFYPXERYZGFDBD-UHFFFAOYSA-N |
| MSDS | msds/85331_1_609_21_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| MTH-DL-Proline | 1968-34-9 | 2A-9085326 |
| PTH-DL-Proline | 4333-21-5 | 2A-9085327 |
| (1-Amino-1-cyclohexyl)phosphonicacid | 67398-11-2 | 2A-9085328 |
| Acetylbromodiethylacetylcarbamide | 77-66-7 | 2A-9085329 |
| 2',4',6'-Trimethoxyacetophenone | 832-58-6 | 2A-9085330 |
| Acetylphosphonicaciddiethylester | 919-19-7 | 2A-9085333 |
| 2,2-Dimethylpropiophenone | 938-16-9 | 2A-9085334 |
| Diethyl1-tetradecanephosphonate | 5191-09-3 | 2A-9085336 |
| (3,4-Dimethoxyphenyl)AcetylChloride | 10313-60-7 | 2A-9085338 |
| 3',4'-(Didecyloxy)acetophenone | 118468-33-0 | 2A-9085339 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS