
CAS Number5580-33-6
Synonyms3,4-dimethyl-benzoic acid amide; 3,4-dimethyl-benzamide; Benzamide,3,4-dimethyl; 3,4-Dimethyl-benzoesaeure-amid; MFCD00052960; 3,4-Dimethylbenzamid
Molecular FormulaC17H19NO
Molecular Weight253.347
Density1.06g/cm3
Boiling Point251.3ºC at 760mmHg
Melting Point101-103°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5580-33-6 |
| Catalog No. | 2A-9085256 |
| Chinese Name | 3,4-二甲基苯甲酰胺 |
| Synonyms | 3,4-dimethyl-benzoic acid amide; 3,4-dimethyl-benzamide; Benzamide,3,4-dimethyl; 3,4-Dimethyl-benzoesaeure-amid; MFCD00052960; 3,4-Dimethylbenzamid |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.347 |
| Density | 1.06g/cm3 |
| Boiling Point | 251.3ºC at 760mmHg |
| Melting Point | 101-103°C |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2924299090 |
| MDL Number | MFCD01215918 |
| SMILES | Cc1ccc(cc1C)C(N)=O |
| InChI | InChI=1S/C9H11NO/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5H,1-2H3,(H2,10,11) |
| InChI Key | InChIKey=INGCXEIJXKQPJH-UHFFFAOYSA-N |
| MSDS | msds/85256_1_5580_33_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-6-methylbenzamide | 101080-58-4 | 2A-9085243 |
| 4-Fluoropheny2-ThienylKetone | 579-49-7 | 2A-9085244 |
| 3-Methoxycarbonyl-3-Sulpholene | 67488-50-0 | 2A-9085248 |
| 3-Acetyl-2-methyl-5H-chromeno[2,3-B]pyridin-5-one | 67867-47-4 | 2A-9085249 |
| 4-Oxo-4-Pyrrolidin-1-yl-butyricacid | 69338-35-8 | 2A-9085252 |
| 3-Chloro-2,6-dimethoxybenzamide | 90346-64-8 | 2A-9085258 |
| 4-Acetamidoantipyrine | 83-15-8 | 2A-9085260 |
| 3-Bromo-5-chloro-2,6-dimethoxybenzamide | 175135-60-1 | 2A-9085261 |
| 2-Amino-N-cyclohexylbenzamide | 56814-11-0 | 2A-9085263 |
| 2-Amino-N-tert-butylbenzamide | 1203-89-0 | 2A-9085266 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA