
CAS Number51584-21-5
SynonymsMFCD00052395; 2,5-dichloro-3,4-dinitro-thiophene; 2,5-Dichlor-3,4-dinitro-thiophen; Thiophene,5-dichloro-3,4-dinitro; Thiophene,2,5-dichloro-3,4-dinitro
Molecular FormulaC6Cl4O2S
Molecular Weight277.942
Density1.921g/cm3
Boiling Point378.7ºC at 760 mmHg
Melting Point85-89°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51584-21-5 |
| Catalog No. | 2A-9085233 |
| Chinese Name | 2,5-二氯-3,4-二硝基噻吩 |
| Synonyms | MFCD00052395; 2,5-dichloro-3,4-dinitro-thiophene; 2,5-Dichlor-3,4-dinitro-thiophen; Thiophene,5-dichloro-3,4-dinitro; Thiophene,2,5-dichloro-3,4-dinitro |
| Molecular Formula | C6Cl4O2S |
| Molecular Weight | 277.942 |
| Density | 1.921g/cm3 |
| Boiling Point | 378.7ºC at 760 mmHg |
| Melting Point | 85-89°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| MDL Number | MFCD00093107 |
| SMILES | O=[N+]([O-])c1c(Cl)sc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C4Cl2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| InChI Key | UNRSLHGBQKYYSF-UHFFFAOYSA-N |
| MSDS | msds/85233_1_51584_21_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(3-Thienylthio)Thiophene | 3807-37-2 | 2A-9085216 |
| 2-Acetyl-7-hydroxybenzofuran | 40020-87-9 | 2A-9085220 |
| 3,4-Dibromo-2,5-Dichlorothiophene | 40477-45-0 | 2A-9085221 |
| Ethyl2-Amino-4-Methylthiophene-3-Carboxylate | 43088-42-2 | 2A-9085226 |
| 1-Benzofuran-5-YLisocyanate | 499770-79-5 | 2A-9085230 |
| 5-Ethoxy-2-Mercaptobenzimidazole | 55489-15-1 | 2A-9085237 |
| 2,5-Dichlorothiophene-3-CarbonylChloride | 57248-14-3 | 2A-9085241 |
| 4-Acetyl-5-methyl-1-phenylpyrazole | 6123-63-3 | 2A-9085245 |
| 2-N-Octylthiophene | 880-36-4 | 2A-9085269 |
| 5-Acetyl-2,3-dihydrobenzo(B)furan | 90843-31-5 | 2A-9085271 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA