
CAS Number30711-40-1
Synonyms1-thiophen-2-yl-heptan-1-one; 2-thienyl hexyl ketone; 1-[2]Thienyl-heptan-1-on; 1-[2]thienyl-heptan-1-one; 1-Heptanone,1-(2-thienyl); 2-Heptanoylthiophene; 1-(2-Thienyl)-1-heptanone; n-Hexyl-2-thienyl-keton; 2-(N-HEPTANOYL)THIOPHENE; MFCD00052588
Molecular FormulaC11H16OS
Molecular Weight196.30900
Density1.026
Boiling Point154-156ºC 15mm
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30711-40-1 |
| Catalog No. | 2A-9085210 |
| Chinese Name | 2-(正庚酰)噻吩 |
| Synonyms | 1-thiophen-2-yl-heptan-1-one; 2-thienyl hexyl ketone; 1-[2]Thienyl-heptan-1-on; 1-[2]thienyl-heptan-1-one; 1-Heptanone,1-(2-thienyl); 2-Heptanoylthiophene; 1-(2-Thienyl)-1-heptanone; n-Hexyl-2-thienyl-keton; 2-(N-HEPTANOYL)THIOPHENE; MFCD00052588 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.30900 |
| Density | 1.026 |
| Boiling Point | 154-156ºC 15mm |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| SMILES | CCCCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
| InChI Key | BDNFJEMAAFFMFH-UHFFFAOYSA-N |
| MSDS | msds/85210_1_30711_40_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Methyl3-Chloro-4-Methylthiophene-2-Carboxylate | 175137-11-8 | 2A-9085182 |
| 2-Acetyl-3-Methylbenzo[B]Thiophene | 18781-31-2 | 2A-9085185 |
| 2-(Trimethylacetyl)Thiophene | 20409-48-7 | 2A-9085188 |
| Methyl3-Chlorobenzo[B]Thiophene-2-Carboxylate | 21211-07-4 | 2A-9085192 |
| Methyl3-(5-Formyl-2-Furyl)-2-Thiophenecarboxylate | 255828-29-6 | 2A-9085203 |
| 2-[(4-Nitrobenzyl)oxy]-1H-isoindole-1,3(2H)-dione | 30777-85-6 | 2A-9085211 |
| 2-Acetyl-5-iodothiophene | 30955-94-3 | 2A-9085212 |
| 2-(3-Thienylthio)Thiophene | 3807-37-2 | 2A-9085216 |
| 2-Acetyl-7-hydroxybenzofuran | 40020-87-9 | 2A-9085220 |
| 3,4-Dibromo-2,5-Dichlorothiophene | 40477-45-0 | 2A-9085221 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA