
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16588-06-0 |
| Catalog No. | 2A-9085125 |
| Chinese Name | 4-氯-3-硝基苯甲酰胺 |
| Synonyms | MFCD00017134; 4-chloro-3-nitrobenzamide; EINECS 240-644-1 |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.582 |
| Density | 1.52g/cm3 |
| Boiling Point | 315.6ºC at 760mmHg |
| Melting Point | 148-150°C |
| Appearance | Solid;White to Yellow to Green powder to crystal |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2924299090 |
| MDL Number | MFCD00017134 |
| SMILES | NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5ClN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| InChI Key | CGXRJCDXGJRBHV-UHFFFAOYSA-N |
| MSDS | msds/85125_1_16588_06_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methoxybenzamide | 2439-77-2 | 2A-9085120 |
| 2,6-Dihydroxybenzamide | 3147-50-0 | 2A-9085121 |
| L-Cystinehydrochloride | 34760-60-5 | 2A-9085122 |
| 4-Bromo-3,5-dihydroxybenzamide | 13429-12-4 | 2A-9085123 |
| 4-Cyanobenzamide | 3034-34-2 | 2A-9085124 |
| 5-(4-Chlorobutyl)hydantoin | 40126-55-4 | 2A-9085130 |
| 2-Amino-4,7-dihydroxypteridine | 529-69-1 | 2A-9085133 |
| 5-Hydantoinaceticacid | 5427-26-9 | 2A-9085134 |
| Ethyl4-hydroxy-8-methoxyquinaldate | 55895-59-5 | 2A-9085135 |
| 1-Acetyl-2-thiohydantoin | 584-26-9 | 2A-9085136 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA