
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 558-96-3 |
| Catalog No. | 2A-9085083 |
| Chinese Name | 十九氟壬烷溴 |
| Synonyms | 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononane; MFCD00153257 |
| Molecular Formula | C9BrF19 |
| Molecular Weight | 548.97 |
| Density | 1,9 g/cm3 |
| Boiling Point | 159 °C |
| Melting Point | 27°C |
| Appearance | white powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| MDL Number | MFCD00153257 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C5H6O3/c6-5(7)4-2-1-3-8-4/h1-2,4H,3H2,(H,6,7) |
| InChI Key | OWIAIPIQXHPUHV-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85083_1_558_96_3.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethylperfluorooctanoate | 3108-24-5 | 2A-9085075 |
| 2-Bromo-3,3,4,4,4-pentafluoro-1-butene | 68318-95-6 | 2A-9085078 |
| 1-Bromopentafluoropropene | 53692-47-0 | 2A-9085079 |
| 2,3-Dibromo-1,3-diphenyl-1-propanone | 611-91-6 | 2A-9085080 |
| 2-Bromopentafluoropropene | 431-49-2 | 2A-9085082 |
| Bis(4-chlorooctafluorobutyl)ether | 149697-40-5 | 2A-9085084 |
| N,O-Bis(diethylhydrogensilyl)trifluoroacetamide | 105384-38-1 | 2A-9085085 |
| Bis(dimethylamino)difluoromethane | 1426-10-4 | 2A-9085086 |
| Bis(trifluoroethyl)amine | 407-01-2 | 2A-9085087 |
| Bis(2,2,2-trifluoroethyl)maleate | 116401-64-0 | 2A-9085088 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA