
CAS Number336-62-9
SynonymsEthyl heptafluorobutyrylacetate; ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoate; Ethyl 2H,2H-perfluoro-3-oxohexanoate; MFCD00015326; Ethyl heptafluorobutanoylacetate; PC3242; 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoic acid ethyl ester; 4,4,5,5,6,6,6-Heptafluor-3-oxo-hexansaeure-aethylester
Molecular FormulaC8H7F7O3
Molecular Weight284.12800
Density1.424g/cm3
Boiling Point170.1ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 336-62-9 |
| Catalog No. | 2A-9085070 |
| Chinese Name | 七氟丁酰基乙酸乙酯 |
| Synonyms | Ethyl heptafluorobutyrylacetate; ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoate; Ethyl 2H,2H-perfluoro-3-oxohexanoate; MFCD00015326; Ethyl heptafluorobutanoylacetate; PC3242; 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoic acid ethyl ester; 4,4,5,5,6,6,6-Heptafluor-3-oxo-hexansaeure-aethylester |
| Molecular Formula | C8H7F7O3 |
| Molecular Weight | 284.12800 |
| Density | 1.424g/cm3 |
| Boiling Point | 170.1ºC at 760mmHg |
| HTC | 2918300090 |
| SMILES | CCOC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI Key | CMGCMFZWEPCGSQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Methoxyquinolin-8-amine | 30465-68-0 | 2A-9085063 |
| 2,3,6-Trimethylacetophenone | 54200-67-8 | 2A-9085065 |
| 4'-Butoxyacetophenone | 5736-89-0 | 2A-9085066 |
| 1,4,5-Triazanaphthalene | 322-46-3 | 2A-9085067 |
| 1-Allylhydantoin | 3366-93-6 | 2A-9085068 |
| Ethylhexafluoroglutarylchloride | 18381-53-8 | 2A-9085071 |
| Ethylpentafluoropropionylacetate | 663-35-4 | 2A-9085072 |
| Ethylperfluoroheptanoate | 41430-70-0 | 2A-9085073 |
| Ethylperfluorononanoate | 30377-52-7 | 2A-9085074 |
| Ethylperfluorooctanoate | 3108-24-5 | 2A-9085075 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA