
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1735-87-1 |
| Catalog No. | 2A-9085022 |
| Chinese Name | 2,2-双(三氟甲基)丙酰胺 |
| Synonyms | hexafluoropivaloyl fluoride; PC0203; 3,3,3-trifluoro-2-methyl-2-trifluoromethyl-propionyl fluoride |
| Molecular Formula | C5H3F7O |
| Molecular Weight | 292.18 |
| Density | 1.447g/cm3 |
| Boiling Point | 57.5ºC at 760mmHg |
| HTC | 2915900090 |
| PubChem ID | 329817576 |
| MDL Number | MFCD24449717 |
| SMILES | FC(F)(F)C1=CN=C(C=C1)C2=CC=C(C(F)(F)F)C=N2 |
| InChI Key | ZHMXQYAUGQASQM-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85022_1_1735_87_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Trifluoromethyl)benzylbromide | 402-43-9 | 2A-9085004 |
| 4-(Trifluoromethyl)benzoylchloride | 327-15-7 | 2A-9085007 |
| 3-Trifluoromethylbenzaldehyde | 455-89-7 | 2A-9085017 |
| 1,2-Dibromotrifluoroethyltrifluoromethylether | 2356-57-2 | 2A-9085019 |
| 1,2-Dichlorotrifluoroethyltrifluoromethylether | 2356-53-8 | 2A-9085020 |
| 4-Chloromethylbenzenesulfonylfluoride | 455-21-0 | 2A-9085028 |
| 4-(2H-Tetrazol-5-yl)benzaldehyde | 74815-22-8 | 2A-9085034 |
| (4-Phthalimidomethylphenyl)boronicacid,pinacolester | 138500-87-5 | 2A-9085046 |
| 1-Bromooctafluoro-1-(trifluoromethyl)cyclopentane | 125112-68-7 | 2A-9085076 |
| 3,4'-Bis(trifluoromethyl)benzhydrol | 203915-48-4 | 2A-9085090 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA