
CAS Number41965-95-1
SynonymsMFCD01211460; (3-Chloro-4-methoxyphenyl)methanamine hydrochloride; Benzenemethanamine, 3-chloro-4-methoxy-, hydrochloride (1:1); (3-chloro-4-methoxyphenyl)methanaminehydrochloride; 3-Chloro-4-methoxybenzylamine Hydrochloride; 1-(3-Chloro-4-methoxyphenyl)methanamine hydrochloride (1:1)
Molecular Formula4-(Cl)-3-(CH3)C6H3OH
Molecular Weight142.58
Purity≥99.0 (GC)%
Boiling Point235-239 °C/1013 hPa
Melting Point63-65 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41965-95-1 |
| Catalog No. | 2A-9085014 |
| Chinese Name | 3-氯-4-甲氧基苄胺 盐酸盐 |
| Synonyms | MFCD01211460; (3-Chloro-4-methoxyphenyl)methanamine hydrochloride; Benzenemethanamine, 3-chloro-4-methoxy-, hydrochloride (1:1); (3-chloro-4-methoxyphenyl)methanaminehydrochloride; 3-Chloro-4-methoxybenzylamine Hydrochloride; 1-(3-Chloro-4-methoxyphenyl)methanamine hydrochloride (1:1) |
| Molecular Formula | 4-(Cl)-3-(CH3)C6H3OH |
| Molecular Weight | 142.58 |
| Purity | ≥99.0 (GC) |
| Boiling Point | 235-239 °C/1013 hPa |
| Melting Point | 63-65 °C |
| Appearance | powder |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2922299090 |
| MDL Number | MFCD00002323 |
| SMILES | Clc1c(cc(cc1)O)C |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChI Key | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| MSDS | msds/85014_1_41965_95_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 3-Chloro-4-methoxybenzylamine hydrochloride Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl2-aminophenylacetate | 64460-85-1 | 2A-9085008 |
| 4-Ethynylaniline | 14235-81-5 | 2A-9085009 |
| 2,4,6-Trimethoxybenzylaminehydrochloride | 146548-59-6 | 2A-9085010 |
| 3-Amino-2-chloro-5-picoline | 34522-13-1 | 2A-9085011 |
| 2-Fluoro-6-methoxybenzylamine | 150517-75-2 | 2A-9085012 |
| 5-Amino-2-chloro-3-picoline | 38168-82-2 | 2A-9085015 |
| 2,3-Dimethoxybenzylamine | 4393-09-3 | 2A-9085016 |
| Nickel(II)trifluoroacetatetetrahydrate | 151013-23-9 | 2A-9085018 |
| 1-Iodononafluoro(3-methylbut-1-ene) | 105774-97-8 | 2A-9085021 |
| Methyl3-morpholinopropionate | 33611-43-7 | 2A-9085024 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA