
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31378-03-7 |
| Catalog No. | 2A-9084982 |
| Chinese Name | 2-(对甲苯磺酰基)苯乙酮 |
| Synonyms | EINECS 250-605-0; 1-phenyl-2-tosylethanone; MFCD00026002; F0873-0004 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.33 |
| Density | 1.227 g/cm3 |
| Boiling Point | 478.1ºC at 760 mmHg |
| Melting Point | 109 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914399090 |
| PubChem ID | 329815560 |
| MDL Number | MFCD08143908 |
| SMILES | CC(=O)c1ccccc1S(=O)(=O)c2ccc(C)cc2 |
| InChI | 1S/C15H14O3S/c1-11-7-9-13(10-8-11)19(17,18)15-6-4-3-5-14(15)12(2)16/h3-10H,1-2H3 |
| InChI Key | DKEQPTKMSRWHJM-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/84982_1_31378_03_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-Amino-4,6-dinitrotoluene | 35572-78-2 | 2A-9084444 |
| Benzenesulfonylacetone | 5000-44-2 | 2A-9084510 |
| Toluene-3,4-dithiolzincsalthydrate | 123333-86-8 | 2A-9084577 |
| Toluene-3,4-dithiolzincsalt | 29726-21-4 | 2A-9084579 |
| N-Acetyl-O-aminoazotoluene | 588-23-8 | 2A-9084703 |
| Bromopentafluoroacetone | 815-23-6 | 2A-9085077 |
| 2-Chloroethylp-toluenesulfonate | 80-41-1 | 2A-9085385 |
| 2-Amino-5-iodotoluene | 13194-68-8 | 2A-9085404 |
| 3-Chloro-5-nitrotoluene | 16582-38-0 | 2A-9085442 |
| 1-(3,4-Dimethoxyphenyl)ethanol | 5653-65-6 | 2A-9085789 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA